Difference between revisions of "OXIDATIVEPENT-PWY"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=INOSINE INOSINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC=NC=23))) * common name: *...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=OXIDATIVEPENT-PWY OXIDATIVEPENT-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?obje...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=OXIDATIVEPENT-PWY OXIDATIVEPENT-PWY] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] | ||
* common name: | * common name: | ||
− | ** | + | ** pentose phosphate pathway (oxidative branch) I |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | * [[ | + | '''3''' reactions found over '''3''' reactions in the full pathway |
− | + | * [[6PGLUCONOLACT-RXN]] | |
− | * [[ | + | ** 5 associated gene(s): |
− | * [[ | + | *** [[Tiso_gene_10799]] |
− | * [[ | + | *** [[Tiso_gene_20412]] |
− | + | *** [[Tiso_gene_5901]] | |
− | * [[ | + | *** [[Tiso_gene_15950]] |
+ | *** [[Tiso_gene_8585]] | ||
+ | ** 6 reconstruction source(s) associated: | ||
+ | *** [[annotation-experimental_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-athaliana]] | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | * [[GLU6PDEHYDROG-RXN]] | ||
+ | ** 2 associated gene(s): | ||
+ | *** [[Tiso_gene_16918]] | ||
+ | *** [[Tiso_gene_14877]] | ||
+ | ** 4 reconstruction source(s) associated: | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-synechocystis]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | * [[RXN-9952]] | ||
+ | ** 5 associated gene(s): | ||
+ | *** [[Tiso_gene_7157]] | ||
+ | *** [[Tiso_gene_19590]] | ||
+ | *** [[Tiso_gene_91]] | ||
+ | *** [[Tiso_gene_777]] | ||
+ | *** [[Tiso_gene_20238]] | ||
+ | ** 3 reconstruction source(s) associated: | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[annotation-in-silico_annotation]] | ||
+ | *** [[orthology-esiliculosus]] | ||
+ | == Reaction(s) not found == | ||
== External links == | == External links == | ||
− | * | + | * ECOCYC: |
− | + | ** [http://metacyc.org/ECOLI/NEW-IMAGE?object=OXIDATIVEPENT-PWY OXIDATIVEPENT-PWY] | |
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: taxonomic range=TAX-2}} | |
− | ** [http:// | + | {{#set: common name=pentose phosphate pathway (oxidative branch) I}} |
− | + | {{#set: reaction found=3}} | |
− | + | {{#set: total reaction=3}} | |
− | + | {{#set: completion rate=100.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:39, 21 March 2018
Pathway OXIDATIVEPENT-PWY
- taxonomic range:
- common name:
- pentose phosphate pathway (oxidative branch) I
- Synonym(s):
Reaction(s) found
3 reactions found over 3 reactions in the full pathway
- 6PGLUCONOLACT-RXN
- 5 associated gene(s):
- 6 reconstruction source(s) associated:
- GLU6PDEHYDROG-RXN
- 2 associated gene(s):
- 4 reconstruction source(s) associated:
- RXN-9952
- 5 associated gene(s):
- 3 reconstruction source(s) associated:
Reaction(s) not found
External links
- ECOCYC: