Difference between revisions of "PWY-6369"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ATROPINE ATROPINE] == * smiles: ** C[N+]1(C2(CC(CC1CC2)OC(=O)C(CO)C3(C=CC=CC=3))) * common name...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6369 PWY-6369] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6369 PWY-6369] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
* common name: | * common name: | ||
| − | ** | + | ** inositol pyrophosphates biosynthesis |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** diphosphorylated inositol polyphosphates biosynthesis |
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''1''' reactions found over '''9''' reactions in the full pathway |
| − | == Reaction(s) | + | * [[RXN-7163]] |
| − | == | + | ** 1 associated gene(s): |
| + | *** [[Tiso_gene_15282]] | ||
| + | ** 1 reconstruction source(s) associated: | ||
| + | *** [[orthology-esiliculosus]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=2.7.1.152-RXN 2.7.1.152-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=2.7.4.24-RXN 2.7.4.24-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-10971 RXN-10971] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-10972 RXN-10972] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-10973 RXN-10973] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-10974 RXN-10974] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-10979 RXN-10979] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-4941 RXN-4941] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2759}} | |
| − | + | {{#set: common name=inositol pyrophosphates biosynthesis}} | |
| − | + | {{#set: common name=diphosphorylated inositol polyphosphates biosynthesis}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=9}} | |
| − | + | {{#set: completion rate=11.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:40, 21 March 2018
Pathway PWY-6369
- taxonomic range:
- common name:
- inositol pyrophosphates biosynthesis
- Synonym(s):
- diphosphorylated inositol polyphosphates biosynthesis
Reaction(s) found
1 reactions found over 9 reactions in the full pathway
- RXN-7163
- 1 associated gene(s):
- 1 reconstruction source(s) associated:
