Difference between revisions of "CPD-8609"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17332 CPD-17332] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)CC(SCCNC(=O)CCNC(=O)C(O)C(C...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8609 CPD-8609] == * smiles: ** CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8609 CPD-8609] == |
* smiles: | * smiles: | ||
− | ** | + | ** CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C |
* common name: | * common name: | ||
− | ** | + | ** 4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=OGQJUYXFIOFTMA-PBJLWWPKSA-N |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 412.698 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[RXN66-14]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN- | + | * [[RXN66-13]] |
+ | * [[RXN-13707]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=167817 167817] |
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=78904 78904] |
− | {{#set: smiles= | + | {{#set: smiles=CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C}} |
− | {{#set: common name= | + | {{#set: common name=4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol}} |
− | {{#set: inchi key=InChIKey= | + | {{#set: inchi key=InChIKey=OGQJUYXFIOFTMA-PBJLWWPKSA-N}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=412.698 }} |
− | + | {{#set: consumed by=RXN66-14}} | |
− | {{#set: consumed by= | + | {{#set: produced by=RXN66-13|RXN-13707}} |
− | {{#set: produced by=RXN- | + |
Latest revision as of 19:40, 21 March 2018
Contents
Metabolite CPD-8609
- smiles:
- CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C
- common name:
- 4,4-dimethyl-5-α-cholesta-8,14-dien-3-β-ol
- inchi key:
- InChIKey=OGQJUYXFIOFTMA-PBJLWWPKSA-N
- molecular weight:
- 412.698
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC([CH]4(C1(C)(C(C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))=CC4)))C" cannot be used as a page name in this wiki.