Difference between revisions of "RXN-11856"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUCROSE-6P SUCROSE-6P] == * smiles: ** C(OP(=O)([O-])[O-])C2(OC(CO)(OC1(OC(CO)C(O)C(O)C(O)1))C(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11856 RXN-11856] == * direction: ** LEFT-TO-RIGHT * common name: ** tRNA (cytosine(34)-C(5))-me...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SUCROSE-6P SUCROSE-6P] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11856 RXN-11856] ==
* smiles:
+
* direction:
** C(OP(=O)([O-])[O-])C2(OC(CO)(OC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)2)
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
** sucrose 6F-phosphate
+
** tRNA (cytosine(34)-C(5))-methyltransferase
* inchi key:
+
* ec number:
** InChIKey=PJTTXANTBQDXME-UGDNZRGBSA-L
+
** [http://enzyme.expasy.org/EC/2.1.1.203 EC-2.1.1.203]
* molecular weight:
+
** [http://enzyme.expasy.org/EC/2.1.1.202 EC-2.1.1.202]
** 420.263   
+
 
* Synonym(s):
 
* Synonym(s):
** sucrose-6F-P
 
** 6-O-phosphonato-β-D-fructofuranosyl α-D-glucopyranoside
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[BFFS]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1 [[Cytosine-34-tRNA-Precursors]][c] '''=>''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[5-METHYLCYTOSINE-34-TRNA-PRECURSORS]][c]
* [[SUCROSE-PHOSPHATE-SYNTHASE-RXN]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 S-adenosyl-L-methionine[c] '''+''' 1 a cytosine34 in tRNA precursor[c] '''=>''' 1 S-adenosyl-L-homocysteine[c] '''+''' 1 H+[c] '''+''' 1 a 5 methylcytosine34 in tRNA precursor[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_3065]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6829]], tRNA methylation (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6829 PWY-6829]
 +
** '''3''' reactions found over '''15''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245080 25245080]
+
{{#set: common name=tRNA (cytosine(34)-C(5))-methyltransferase}}
* CHEBI:
+
{{#set: ec number=EC-2.1.1.203}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57723 57723]
+
{{#set: ec number=EC-2.1.1.202}}
* BIGG : suc6p
+
{{#set: gene associated=Tiso_gene_3065}}
* LIGAND-CPD:
+
{{#set: in pathway=PWY-6829}}
** [http://www.genome.jp/dbget-bin/www_bget?C02591 C02591]
+
{{#set: reconstruction category=annotation}}
{{#set: smiles=C(OP(=O)([O-])[O-])C2(OC(CO)(OC1(OC(CO)C(O)C(O)C(O)1))C(O)C(O)2)}}
+
{{#set: reconstruction source=annotation-experimental_annotation}}
{{#set: common name=sucrose 6F-phosphate}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: inchi key=InChIKey=PJTTXANTBQDXME-UGDNZRGBSA-L}}
+
{{#set: molecular weight=420.263    }}
+
{{#set: common name=sucrose-6F-P|6-O-phosphonato-β-D-fructofuranosyl α-D-glucopyranoside}}
+
{{#set: consumed by=BFFS}}
+
{{#set: produced by=SUCROSE-PHOSPHATE-SYNTHASE-RXN}}
+

Latest revision as of 19:40, 21 March 2018

Reaction RXN-11856

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • tRNA (cytosine(34)-C(5))-methyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6829, tRNA methylation (yeast): PWY-6829
    • 3 reactions found over 15 reactions in the full pathway

Reconstruction information

External links