Difference between revisions of "RXN-13482"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2189 CPD0-2189] == * smiles: ** C(O)C(O)C([N+])C(=O)[O-] * common name: ** 4-hydroxy-L-thr...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13482 RXN-13482] == * direction: ** REVERSIBLE * common name: ** ornithine carbamoyltransferase...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2189 CPD0-2189] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13482 RXN-13482] ==
−
* smiles:
+
* direction:
−
** C(O)C(O)C([N+])C(=O)[O-]
+
** REVERSIBLE
 
* common name:
 
* common name:
−
** 4-hydroxy-L-threonine
+
** ornithine carbamoyltransferase
−
* inchi key:
+
* ec number:
−
** InChIKey=JBNUARFQOCGDRK-GBXIJSLDSA-N
+
** [http://enzyme.expasy.org/EC/2.1.3.3 EC-2.1.3.3]
−
* molecular weight:
+
−
** 135.119   
+
 
* Synonym(s):
 
* Synonym(s):
−
** (2S,3S)-2-amino-3,4-dihydroxybutanoic acid
 
−
** hydroxythreonine
 
−
** 3-hydroxyhomoserine
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-14125]]
+
** 1 [[L-ORNITHINE]][c] '''+''' 1 [[CARBAMOYL-P]][c] '''<=>''' 1 [[Pi]][c] '''+''' 1 [[L-CITRULLINE]][c] '''+''' 1 [[PROTON]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 L-ornithine[c] '''+''' 1 carbamoyl phosphate[c] '''<=>''' 1 phosphate[c] '''+''' 1 L-citrulline[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_18444]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 21768-45-6
+
{{#set: direction=REVERSIBLE}}
−
* PUBCHEM:
+
{{#set: common name=ornithine carbamoyltransferase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49852420 49852420]
+
{{#set: ec number=EC-2.1.3.3}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Tiso_gene_18444}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06056 C06056]
+
{{#set: in pathway=}}
−
* CHEMSPIDER:
+
{{#set: reconstruction category=orthology|annotation}}
−
** [http://www.chemspider.com/Chemical-Structure.167988.html 167988]
+
{{#set: reconstruction source=annotation-experimental_annotation|orthology-esiliculosus}}
−
* CHEBI:
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60904 60904]
+
−
* BIGG : 4hthr
+
−
{{#set: smiles=C(O)C(O)C([N+])C(=O)[O-]}}
+
−
{{#set: common name=4-hydroxy-L-threonine}}
+
−
{{#set: inchi key=InChIKey=JBNUARFQOCGDRK-GBXIJSLDSA-N}}
+
−
{{#set: molecular weight=135.119    }}
+
−
{{#set: common name=(2S,3S)-2-amino-3,4-dihydroxybutanoic acid|hydroxythreonine|3-hydroxyhomoserine}}
+
−
{{#set: produced by=RXN-14125}}
+

Latest revision as of 20:41, 21 March 2018

Reaction RXN-13482

  • direction:
    • REVERSIBLE
  • common name:
    • ornithine carbamoyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 L-ornithine[c] + 1 carbamoyl phosphate[c] <=> 1 phosphate[c] + 1 L-citrulline[c] + 1 H+[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-13482&oldid=43193"