Difference between revisions of "CPD-12017"

Latest revision as of 19:43, 21 March 2018

"CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
-[[Category:Gene]]
+[[Category:Metabolite]]
-== Gene Tiso_gene_1666 ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12017 CPD-12017] ==
+* smiles:
+** CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))
+* common name:
+** N-acetyl-serotonin sulfate
+* inchi key:
+** InChIKey=UCAJZNVFRVLULS-UHFFFAOYSA-M
+* molecular weight:
+** 297.305
 * Synonym(s):
+** N-acetyl-5-hydroxytryptamine sulfate
-== Reactions associated ==
+== Reaction(s) known to consume the compound ==
-* Reaction: [[GSHTRAN-RXN]]
+== Reaction(s) known to produce the compound ==
-** Source: [[orthology-athaliana]]
+* [[RXN-11059]]
-== Pathways associated ==
+== Reaction(s) of unknown directionality ==
-* [[PWY-6842]]
-* [[PWY-4061]]
 == External links  ==
-{{#set: reaction associated=GSHTRAN-RXN}}
+* PUBCHEM:
-{{#set: pathway associated=PWY-6842|PWY-4061}}
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102514958 102514958]
+* HMDB : HMDB60834
+{{#set: smiles=CC(=O)NCCC1(=CNC2(=CC=C(OS([O-])(=O)=O)C=C12))}}
+{{#set: common name=N-acetyl-serotonin sulfate}}
+{{#set: inchi key=InChIKey=UCAJZNVFRVLULS-UHFFFAOYSA-M}}
+{{#set: molecular weight=297.305    }}
+{{#set: common name=N-acetyl-5-hydroxytryptamine sulfate}}
+{{#set: produced by=RXN-11059}}