Difference between revisions of "PWY-1361"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7535 CPD-7535] == * smiles: ** CC(=CCCC(C)=CCCC(C)=CC=CC(=CC=CC=C(C=CC=C(CCC=C(CCC=C(C)C)C)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-1361 PWY-1361] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7535 CPD-7535] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-1361 PWY-1361] ==
* smiles:
+
* taxonomic range:
** CC(=CCCC(C)=CCCC(C)=CC=CC(=CC=CC=C(C=CC=C(CCC=C(CCC=C(C)C)C)C)C)C)C
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
* inchi key:
+
** InChIKey=BIWLELKAFXRPDE-LMARSQGMSA-N
+
 
* common name:
 
* common name:
** 9,15,9'-tri-cis-ζ-carotene
+
** benzoyl-CoA degradation I (aerobic)
* molecular weight:
+
** 540.914   
+
 
* Synonym(s):
 
* Synonym(s):
** 9,15,9'-cis-ζ-carotene
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-11354]]
+
'''2''' reactions found over '''7''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[RXN-2425]]
* [[RXN-12244]]
+
** 2 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_5857]]
 +
*** [[Tiso_gene_14257]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN0-2044]]
 +
** 6 associated gene(s):
 +
*** [[Tiso_gene_18839]]
 +
*** [[Tiso_gene_14027]]
 +
*** [[Tiso_gene_14262]]
 +
*** [[Tiso_gene_5857]]
 +
*** [[Tiso_gene_14026]]
 +
*** [[Tiso_gene_18838]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[annotation-experimental_annotation]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11053 RXN-11053]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-11054 RXN-11054]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-2401 RXN-2401]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-2424 RXN-2424]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-3641 RXN-3641]
 
== External links  ==
 
== External links  ==
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-2}}
** [http://www.genome.jp/dbget-bin/www_bget?C19764 C19764]
+
{{#set: common name=benzoyl-CoA degradation I (aerobic)}}
* CHEBI:
+
{{#set: reaction found=2}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=48717 48717]
+
{{#set: total reaction=7}}
* PUBCHEM:
+
{{#set: completion rate=29.0}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24755586 24755586]
+
{{#set: smiles=CC(=CCCC(C)=CCCC(C)=CC=CC(=CC=CC=C(C=CC=C(CCC=C(CCC=C(C)C)C)C)C)C)C}}
+
{{#set: inchi key=InChIKey=BIWLELKAFXRPDE-LMARSQGMSA-N}}
+
{{#set: common name=9,15,9'-tri-cis-ζ-carotene}}
+
{{#set: molecular weight=540.914    }}
+
{{#set: common name=9,15,9'-cis-ζ-carotene}}
+
{{#set: consumed by=RXN-11354}}
+
{{#set: produced by=RXN-12244}}
+

Latest revision as of 19:43, 21 March 2018

Pathway PWY-1361

  • taxonomic range:
  • common name:
    • benzoyl-CoA degradation I (aerobic)
  • Synonym(s):

Reaction(s) found

2 reactions found over 7 reactions in the full pathway

Reaction(s) not found

External links