Difference between revisions of "RXN-12729"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-FORMYL-THF 5-FORMYL-THF] == * smiles: ** C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))[CH]...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12729 RXN-12729] == * direction: ** LEFT-TO-RIGHT * common name: ** cystathione_gamma * ec numb...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-FORMYL-THF 5-FORMYL-THF] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12729 RXN-12729] ==
−
* smiles:
+
* direction:
−
** C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))[CH]3(CNC2(=C(C(=O)NC(N)=N2)N([CH]=O)3))
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** (6S)-5-formyl-tetrahydrofolate mono-L-glutamate
+
** cystathione_gamma
−
* inchi key:
+
* ec number:
−
** InChIKey=VVIAGPKUTFNRDU-STQMWFEESA-L
+
** [http://enzyme.expasy.org/EC/4.4.1.8 EC-4.4.1.8]
−
* molecular weight:
+
−
** 471.429   
+
 
* Synonym(s):
 
* Synonym(s):
−
** n5-formyltetrahydrofolate monoglutamate
 
−
** n5-formyl-thf monoglutamate
 
−
** N5-formyl-THF monoglutamate
 
−
** 5-formyl-H4F monoglutamate
 
−
** 5-formyl-THF monoglutamate
 
−
** folinic acid monoglutamate
 
−
** 5-CHO-THF monoglutamate
 
−
** folinate
 
−
** formyl-H4F monoglutamate
 
−
** citrovorum factor
 
−
** N5-formyl-H4F monoglutamate
 
−
** N5-formyl-H4PteGlu1
 
−
** (6S)-leucovorin
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1 [[CPD-13717]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[PYRUVATE]][c] '''+''' 1 [[AMMONIUM]][c] '''+''' 1 [[SELENOHOMOCYSTEINE]][c]
−
* [[5FTHFt]]
+
* With common name(s):
−
* [[5FTHFtm]]
+
** 1 L-selenocystathionine[c] '''+''' 1 H2O[c] '''=>''' 1 pyruvate[c] '''+''' 1 ammonium[c] '''+''' 1 seleno-L-homocysteine[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_3732]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[orthology-creinhardtii]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
* [[PWY-6936]], seleno-amino acid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6936 PWY-6936]
 +
** '''4''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 58-05-9
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=cystathione_gamma}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6560146 6560146]
+
{{#set: ec number=EC-4.4.1.8}}
−
* HMDB : HMDB01562
+
{{#set: gene associated=Tiso_gene_3732}}
−
* LIGAND-CPD:
+
{{#set: in pathway=PWY-6936}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C03479 C03479]
+
{{#set: reconstruction category=orthology|annotation}}
−
* CHEMSPIDER:
+
{{#set: reconstruction source=annotation-in-silico_annotation|orthology-creinhardtii|annotation-experimental_annotation}}
−
** [http://www.chemspider.com/Chemical-Structure.5028014.html 5028014]
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57457 57457]
+
−
* METABOLIGHTS : MTBLC57457
+
−
{{#set: smiles=C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))[CH]3(CNC2(=C(C(=O)NC(N)=N2)N([CH]=O)3))}}
+
−
{{#set: common name=(6S)-5-formyl-tetrahydrofolate mono-L-glutamate}}
+
−
{{#set: inchi key=InChIKey=VVIAGPKUTFNRDU-STQMWFEESA-L}}
+
−
{{#set: molecular weight=471.429    }}
+
−
{{#set: common name=n5-formyltetrahydrofolate monoglutamate|n5-formyl-thf monoglutamate|N5-formyl-THF monoglutamate|5-formyl-H4F monoglutamate|5-formyl-THF monoglutamate|folinic acid monoglutamate|5-CHO-THF monoglutamate|folinate|formyl-H4F monoglutamate|citrovorum factor|N5-formyl-H4F monoglutamate|N5-formyl-H4PteGlu1|(6S)-leucovorin}}
+
−
{{#set: reversible reaction associated=5FTHFt|5FTHFtm}}
+

Latest revision as of 19:44, 21 March 2018

Reaction RXN-12729

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • cystathione_gamma
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6936, seleno-amino acid biosynthesis: PWY-6936
    • 4 reactions found over 5 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-12729&oldid=43523"