Difference between revisions of "PWY-6531"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14928 CPD-14928] == * smiles: ** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6531 PWY-6531] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2870 TAX-28...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14928 CPD-14928] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6531 PWY-6531] ==
* smiles:
+
* taxonomic range:
** CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2870 TAX-2870]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-5794 TAX-5794]
 
* common name:
 
* common name:
** phytenoyl-CoA
+
** mannitol cycle
* inchi key:
+
** InChIKey=NYZPDFUAZACYOT-PEAQSEFFSA-J
+
* molecular weight:
+
** 1056.006   
+
 
* Synonym(s):
 
* Synonym(s):
** E-phytenoyl-CoA
 
** trans-phytenoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN66-482]]
+
'''4''' reactions found over '''5''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[FRUCTOKINASE-RXN]]
* [[RXN66-480]]
+
** 3 associated gene(s):
== Reaction(s) of unknown directionality ==
+
*** [[Tiso_gene_1303]]
 +
*** [[Tiso_gene_17974]]
 +
*** [[Tiso_gene_3107]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[MANNITOL-1-PHOSPHATASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_2123]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[annotation-experimental_annotation]]
 +
* [[MANNPDEHYDROG-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_15319]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[orthology-esiliculosus]]
 +
* [[RXN-14515]]
 +
** 0 associated gene:
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=MANNITOL-2-DEHYDROGENASE-RXN MANNITOL-2-DEHYDROGENASE-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* LIGAND-MAP:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657969 90657969]
+
** [http://www.genome.jp/dbget-bin/www_bget?map00051 map00051]
{{#set: smiles=CC(C)CCCC(C)CCCC(C)CCCC(C)=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
+
{{#set: taxonomic range=TAX-2870}}
{{#set: common name=phytenoyl-CoA}}
+
{{#set: taxonomic range=TAX-5794}}
{{#set: inchi key=InChIKey=NYZPDFUAZACYOT-PEAQSEFFSA-J}}
+
{{#set: common name=mannitol cycle}}
{{#set: molecular weight=1056.006    }}
+
{{#set: reaction found=4}}
{{#set: common name=E-phytenoyl-CoA|trans-phytenoyl-CoA}}
+
{{#set: total reaction=5}}
{{#set: consumed by=RXN66-482}}
+
{{#set: completion rate=80.0}}
{{#set: produced by=RXN66-480}}
+

Latest revision as of 19:44, 21 March 2018

Pathway PWY-6531

Reaction(s) found

4 reactions found over 5 reactions in the full pathway

Reaction(s) not found

External links