Difference between revisions of "PWY-5526"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13559 CPD-13559] == * smiles: ** C(O)C1(C(O)C(O)C(O)C(O)O1) * common name: ** α-D-man...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5526 PWY-5526] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-93681 TAX-9...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5526 PWY-5526] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-93681 TAX-93681] |
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-204457 TAX-204457] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-204455 TAX-204455] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-356 TAX-356] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-191412 TAX-191412] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-1046 TAX-1046] | ||
+ | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-204441 TAX-204441] | ||
* common name: | * common name: | ||
− | ** | + | ** bacteriochlorophyll a biosynthesis |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction(s) found == |
− | == Reaction(s) | + | '''1''' reactions found over '''13''' reactions in the full pathway |
− | * [[ | + | * [[RXN-5286]] |
− | == | + | ** 1 associated gene(s): |
+ | *** [[Tiso_gene_13868]] | ||
+ | ** 2 reconstruction source(s) associated: | ||
+ | *** [[manual-primary_network]] | ||
+ | *** [[orthology-creinhardtii]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17424 RXN-17424] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17425 RXN-17425] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-17491 RXN-17491] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8785 RXN-8785] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8786 RXN-8786] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8787 RXN-8787] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8788 RXN-8788] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8789 RXN-8789] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8790 RXN-8790] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8791 RXN-8791] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8792 RXN-8792] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-8793 RXN-8793] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-93681}} | |
− | + | {{#set: taxonomic range=TAX-204457}} | |
− | + | {{#set: taxonomic range=TAX-204455}} | |
− | + | {{#set: taxonomic range=TAX-356}} | |
− | + | {{#set: taxonomic range=TAX-191412}} | |
− | + | {{#set: taxonomic range=TAX-1046}} | |
− | + | {{#set: taxonomic range=TAX-204441}} | |
− | {{#set: | + | {{#set: common name=bacteriochlorophyll a biosynthesis}} |
− | {{#set: common name= | + | {{#set: reaction found=1}} |
− | {{#set: | + | {{#set: total reaction=13}} |
− | {{#set: | + | {{#set: completion rate=8.0}} |
− | {{#set: | + |
Latest revision as of 20:44, 21 March 2018
Pathway PWY-5526
- taxonomic range:
- common name:
- bacteriochlorophyll a biosynthesis
- Synonym(s):
Reaction(s) found
1 reactions found over 13 reactions in the full pathway
- RXN-5286
- 1 associated gene(s):
- 2 reconstruction source(s) associated:
Reaction(s) not found
- RXN-17424
- RXN-17425
- RXN-17491
- RXN-8785
- RXN-8786
- RXN-8787
- RXN-8788
- RXN-8789
- RXN-8790
- RXN-8791
- RXN-8792
- RXN-8793