Difference between revisions of "CPDQT-27"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=P124-PWY P124-PWY] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-201174 TAX-...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-27 CPDQT-27] == * smiles: ** CSCCCCC(=O)C([O-])=O * common name: ** 6-(methylthio)-2-oxoh...")
 
Line 1: Line 1:
[[Category:Pathway]]
+
[[Category:Metabolite]]
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=P124-PWY P124-PWY] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-27 CPDQT-27] ==
* taxonomic range:
+
* smiles:
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-201174 TAX-201174]
+
** CSCCCCC(=O)C([O-])=O
 
* common name:
 
* common name:
** Bifidobacterium shunt
+
** 6-(methylthio)-2-oxohexanoate
 +
* inchi key:
 +
** InChIKey=GRUGZHAOXOPASC-UHFFFAOYSA-M
 +
* molecular weight:
 +
** 175.222   
 
* Synonym(s):
 
* Synonym(s):
** Bifidum fermentation
+
** 6-(methylthio)-2-oxohexanoic acid
** Bifidum pathway
+
** fructose-6-phosphate pathway
+
** Bifidum shunt
+
** glucose fermentation to lactate (Bifidobacteria)
+
  
== Reaction(s) found ==
+
== Reaction(s) known to consume the compound ==
'''11''' reactions found over '''15''' reactions in the full pathway
+
== Reaction(s) known to produce the compound ==
* [[1TRANSKETO-RXN]]
+
* [[RXN-18209]]
** 2 associated gene(s):
+
* [[RXNQT-4165]]
*** [[Tiso_gene_11559]]
+
== Reaction(s) of unknown directionality ==
*** [[Tiso_gene_5008]]
+
** 5 reconstruction source(s) associated:
+
*** [[annotation-in-silico_annotation]]
+
*** [[orthology-athaliana]]
+
*** [[annotation-experimental_annotation]]
+
*** [[orthology-synechocystis]]
+
*** [[manual-primary_network]]
+
* [[2PGADEHYDRAT-RXN]]
+
** 4 associated gene(s):
+
*** [[Tiso_gene_8720]]
+
*** [[Tiso_gene_14718]]
+
*** [[Tiso_gene_5619]]
+
*** [[Tiso_gene_13317]]
+
** 7 reconstruction source(s) associated:
+
*** [[annotation-experimental_annotation]]
+
*** [[orthology-esiliculosus]]
+
*** [[annotation-in-silico_annotation]]
+
*** [[orthology-athaliana]]
+
*** [[orthology-synechocystis]]
+
*** [[manual-primary_network]]
+
*** [[orthology-creinhardtii]]
+
* [[3PGAREARR-RXN]]
+
** 16 associated gene(s):
+
*** [[Tiso_gene_15048]]
+
*** [[Tiso_gene_7201]]
+
*** [[Tiso_gene_9922]]
+
*** [[Tiso_gene_2841]]
+
*** [[Tiso_gene_14530]]
+
*** [[Tiso_gene_16754]]
+
*** [[Tiso_gene_2365]]
+
*** [[Tiso_gene_16271]]
+
*** [[Tiso_gene_5468]]
+
*** [[Tiso_gene_20311]]
+
*** [[Tiso_gene_14664]]
+
*** [[Tiso_gene_15391]]
+
*** [[Tiso_gene_14212]]
+
*** [[Tiso_gene_10516]]
+
*** [[Tiso_gene_9923]]
+
*** [[Tiso_gene_2667]]
+
** 7 reconstruction source(s) associated:
+
*** [[annotation-experimental_annotation]]
+
*** [[orthology-esiliculosus]]
+
*** [[annotation-in-silico_annotation]]
+
*** [[orthology-athaliana]]
+
*** [[orthology-synechocystis]]
+
*** [[manual-primary_network]]
+
*** [[orthology-creinhardtii]]
+
* [[GAPOXNPHOSPHN-RXN]]
+
** 5 associated gene(s):
+
*** [[Tiso_gene_20000]]
+
*** [[Tiso_gene_235]]
+
*** [[Tiso_gene_10646]]
+
*** [[Tiso_gene_3344]]
+
*** [[Tiso_gene_6766]]
+
** 7 reconstruction source(s) associated:
+
*** [[annotation-experimental_annotation]]
+
*** [[orthology-esiliculosus]]
+
*** [[annotation-in-silico_annotation]]
+
*** [[orthology-athaliana]]
+
*** [[orthology-synechocystis]]
+
*** [[manual-primary_network]]
+
*** [[orthology-creinhardtii]]
+
* [[GLUCOKIN-RXN]]
+
** 2 associated gene(s):
+
*** [[Tiso_gene_3107]]
+
*** [[Tiso_gene_1303]]
+
** 4 reconstruction source(s) associated:
+
*** [[annotation-experimental_annotation]]
+
*** [[annotation-in-silico_annotation]]
+
*** [[orthology-synechocystis]]
+
*** [[orthology-esiliculosus]]
+
* [[PEPDEPHOS-RXN]]
+
** 4 associated gene(s):
+
*** [[Tiso_gene_18206]]
+
*** [[Tiso_gene_14504]]
+
*** [[Tiso_gene_974]]
+
*** [[Tiso_gene_14505]]
+
** 7 reconstruction source(s) associated:
+
*** [[annotation-experimental_annotation]]
+
*** [[orthology-esiliculosus]]
+
*** [[annotation-in-silico_annotation]]
+
*** [[orthology-athaliana]]
+
*** [[orthology-synechocystis]]
+
*** [[manual-primary_network]]
+
*** [[orthology-creinhardtii]]
+
* [[PGLUCISOM-RXN]]
+
** 1 associated gene(s):
+
*** [[Tiso_gene_19480]]
+
** 3 reconstruction source(s) associated:
+
*** [[annotation-experimental_annotation]]
+
*** [[annotation-in-silico_annotation]]
+
*** [[orthology-esiliculosus]]
+
* [[PHOSGLYPHOS-RXN]]
+
** 6 associated gene(s):
+
*** [[Tiso_gene_3526]]
+
*** [[Tiso_gene_18264]]
+
*** [[Tiso_gene_3527]]
+
*** [[Tiso_gene_18263]]
+
*** [[Tiso_gene_12104]]
+
*** [[Tiso_gene_14642]]
+
** 7 reconstruction source(s) associated:
+
*** [[annotation-experimental_annotation]]
+
*** [[orthology-esiliculosus]]
+
*** [[annotation-in-silico_annotation]]
+
*** [[orthology-athaliana]]
+
*** [[orthology-synechocystis]]
+
*** [[manual-primary_network]]
+
*** [[orthology-creinhardtii]]
+
* [[RIB5PISOM-RXN]]
+
** 1 associated gene(s):
+
*** [[Tiso_gene_18217]]
+
** 5 reconstruction source(s) associated:
+
*** [[orthology-athaliana]]
+
*** [[annotation-in-silico_annotation]]
+
*** [[orthology-synechocystis]]
+
*** [[orthology-esiliculosus]]
+
*** [[manual-primary_network]]
+
* [[RIBULP3EPIM-RXN]]
+
** 3 associated gene(s):
+
*** [[Tiso_gene_19140]]
+
*** [[Tiso_gene_4754]]
+
*** [[Tiso_gene_10879]]
+
** 7 reconstruction source(s) associated:
+
*** [[annotation-experimental_annotation]]
+
*** [[orthology-esiliculosus]]
+
*** [[annotation-in-silico_annotation]]
+
*** [[orthology-athaliana]]
+
*** [[orthology-synechocystis]]
+
*** [[manual-primary_network]]
+
*** [[orthology-creinhardtii]]
+
* [[TRANSALDOL-RXN]]
+
** 2 associated gene(s):
+
*** [[Tiso_gene_17601]]
+
*** [[Tiso_gene_1831]]
+
** 6 reconstruction source(s) associated:
+
*** [[annotation-experimental_annotation]]
+
*** [[orthology-esiliculosus]]
+
*** [[annotation-in-silico_annotation]]
+
*** [[orthology-athaliana]]
+
*** [[manual-primary_network]]
+
*** [[orthology-creinhardtii]]
+
== Reaction(s) not found ==
+
* [http://metacyc.org/META/NEW-IMAGE?object=ACETATEKIN-RXN ACETATEKIN-RXN]
+
* [http://metacyc.org/META/NEW-IMAGE?object=FRUCTOSE-6-PHOSPHATE-PHOSPHOKETOLASE-RXN FRUCTOSE-6-PHOSPHATE-PHOSPHOKETOLASE-RXN]
+
* [http://metacyc.org/META/NEW-IMAGE?object=L-LACTATE-DEHYDROGENASE-RXN L-LACTATE-DEHYDROGENASE-RXN]
+
* [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHOKETOLASE-RXN PHOSPHOKETOLASE-RXN]
+
 
== External links  ==
 
== External links  ==
{{#set: taxonomic range=TAX-201174}}
+
* PUBCHEM:
{{#set: common name=Bifidobacterium shunt}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237195 44237195]
{{#set: common name=Bifidum fermentation|Bifidum pathway|fructose-6-phosphate pathway|Bifidum shunt|glucose fermentation to lactate (Bifidobacteria)}}
+
* KNAPSACK : C00007648
{{#set: reaction found=11}}
+
{{#set: smiles=CSCCCCC(=O)C([O-])=O}}
{{#set: total reaction=15}}
+
{{#set: common name=6-(methylthio)-2-oxohexanoate}}
{{#set: completion rate=73.0}}
+
{{#set: inchi key=InChIKey=GRUGZHAOXOPASC-UHFFFAOYSA-M}}
 +
{{#set: molecular weight=175.222    }}
 +
{{#set: common name=6-(methylthio)-2-oxohexanoic acid}}
 +
{{#set: produced by=RXN-18209|RXNQT-4165}}

Latest revision as of 19:44, 21 March 2018

Metabolite CPDQT-27

  • smiles:
    • CSCCCCC(=O)C([O-])=O
  • common name:
    • 6-(methylthio)-2-oxohexanoate
  • inchi key:
    • InChIKey=GRUGZHAOXOPASC-UHFFFAOYSA-M
  • molecular weight:
    • 175.222
  • Synonym(s):
    • 6-(methylthio)-2-oxohexanoic acid

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • PUBCHEM:
  • KNAPSACK : C00007648
"CSCCCCC(=O)C([O-])=O" cannot be used as a page name in this wiki.