Difference between revisions of "CPD-13912"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18118 CPD-18118] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) * common name: ** D-...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13912 CPD-13912] == * smiles: ** C(C(C(O)C(C([O-])=O)(C([O-])=O)O)O)O * common name: ** 2-c...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13912 CPD-13912] == |
* smiles: | * smiles: | ||
| − | ** C( | + | ** C(C(C(O)C(C([O-])=O)(C([O-])=O)O)O)O |
* common name: | * common name: | ||
| − | ** | + | ** 2-carboxy-L-threo-pentonate |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=CQIRJDZGDXTXKF-UHFFFAOYSA-L |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 208.124 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 2-carboxy-L-xylonate |
| + | ** 2-hydroxy-2-(1,2,3-trihydroxypropyl)propanedioate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-12871]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657336 90657336] |
| − | + | {{#set: smiles=C(C(C(O)C(C([O-])=O)(C([O-])=O)O)O)O}} | |
| − | + | {{#set: common name=2-carboxy-L-threo-pentonate}} | |
| − | {{#set: smiles=C( | + | {{#set: inchi key=InChIKey=CQIRJDZGDXTXKF-UHFFFAOYSA-L}} |
| − | {{#set: common name= | + | {{#set: molecular weight=208.124 }} |
| − | {{#set: inchi key=InChIKey= | + | {{#set: common name=2-carboxy-L-xylonate|2-hydroxy-2-(1,2,3-trihydroxypropyl)propanedioate}} |
| − | {{#set: molecular weight= | + | {{#set: produced by=RXN-12871}} |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
Latest revision as of 19:44, 21 March 2018
Contents
Metabolite CPD-13912
- smiles:
- C(C(C(O)C(C([O-])=O)(C([O-])=O)O)O)O
- common name:
- 2-carboxy-L-threo-pentonate
- inchi key:
- InChIKey=CQIRJDZGDXTXKF-UHFFFAOYSA-L
- molecular weight:
- 208.124
- Synonym(s):
- 2-carboxy-L-xylonate
- 2-hydroxy-2-(1,2,3-trihydroxypropyl)propanedioate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(C(C(O)C(C([O-])=O)(C([O-])=O)O)O)O" cannot be used as a page name in this wiki.
