Difference between revisions of "Tiso gene 15903"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-MANNONATE D-MANNONATE] == * smiles: ** C(O)C(C(O)C(O)C(C([O-])=O)O)O * common name: ** D-mann...") |
(Created page with "Category:Gene == Gene Tiso_gene_15903 == * right end position: ** 3206 * transcription direction: ** POSITIVE * left end position: ** 1708 * centisome position: ** 36.2325...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_15903 == |
− | * | + | * right end position: |
− | ** | + | ** 3206 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 1708 |
− | * | + | * centisome position: |
− | ** | + | ** 36.2325 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == | + | == Reactions associated == |
− | * [[ | + | * Reaction: [[HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | + | *** Assignment: ec-number | |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
+ | * Reaction: [[RXN-11201]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=3206}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=1708}} | |
− | + | {{#set: centisome position=36.2325 }} | |
− | + | {{#set: reaction associated=HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN|RXN-11201}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + |
Latest revision as of 19:46, 21 March 2018
Gene Tiso_gene_15903
- right end position:
- 3206
- transcription direction:
- POSITIVE
- left end position:
- 1708
- centisome position:
- 36.2325
- Synonym(s):
Reactions associated
- Reaction: HISTONE-LYSINE-N-METHYLTRANSFERASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: RXN-11201
- Source: orthology-esiliculosus