Difference between revisions of "PWY-7391"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYLETHYLAMINE PHENYLETHYLAMINE] == * smiles: ** C([N+])CC1(=CC=CC=C1) * common name: ** 2-ph...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7391 PWY-7391] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-21...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYLETHYLAMINE PHENYLETHYLAMINE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-7391 PWY-7391] ==
−
* smiles:
+
* taxonomic range:
−
** C([N+])CC1(=CC=CC=C1)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33208 TAX-33208]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
 
* common name:
 
* common name:
−
** 2-phenylethylamine
+
** isoprene biosynthesis II (engineered)
−
* inchi key:
+
−
** InChIKey=BHHGXPLMPWCGHP-UHFFFAOYSA-O
+
−
* molecular weight:
+
−
** 122.189   
+
 
* Synonym(s):
 
* Synonym(s):
−
** β-phenylethylamine
+
** isoprenoid pathway
−
** phenylethylamine
+
** MVA pathway
−
** phenethylamine
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[AMINEPHEN-RXN]]
+
'''6''' reactions found over '''8''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[1.1.1.34-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** 2 associated gene(s):
 +
*** [[Tiso_gene_16182]]
 +
*** [[Tiso_gene_17889]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-in-silico_annotation]]
 +
* [[ACETYL-COA-ACETYLTRANSFER-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_16181]]
 +
*** [[Tiso_gene_15327]]
 +
*** [[Tiso_gene_17451]]
 +
** 4 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[orthology-creinhardtii]]
 +
*** [[orthology-synechocystis]]
 +
*** [[orthology-esiliculosus]]
 +
* [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_4171]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[HYDROXYMETHYLGLUTARYL-COA-SYNTHASE-RXN]]
 +
** 3 associated gene(s):
 +
*** [[Tiso_gene_9236]]
 +
*** [[Tiso_gene_14303]]
 +
*** [[Tiso_gene_8563]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
* [[IPPISOM-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_8653]]
 +
** 2 reconstruction source(s) associated:
 +
*** [[manual-primary_network]]
 +
*** [[annotation-in-silico_annotation]]
 +
* [[MEVALONATE-KINASE-RXN]]
 +
** 1 associated gene(s):
 +
*** [[Tiso_gene_3811]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=4.2.3.27-RXN 4.2.3.27-RXN]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHOMEVALONATE-KINASE-RXN PHOSPHOMEVALONATE-KINASE-RXN]
 
== External links  ==
 
== External links  ==
−
* CAS : 64-04-0
+
{{#set: taxonomic range=TAX-2157}}
−
* BIGG : peamn
+
{{#set: taxonomic range=TAX-33208}}
−
* DRUGBANK : DB04325
+
{{#set: taxonomic range=TAX-4751}}
−
* PUBCHEM:
+
{{#set: taxonomic range=TAX-2}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=448751 448751]
+
{{#set: taxonomic range=TAX-33090}}
−
* HMDB : HMDB12275
+
{{#set: common name=isoprene biosynthesis II (engineered)}}
−
* LIGAND-CPD:
+
{{#set: common name=isoprenoid pathway|MVA pathway}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05332 C05332]
+
{{#set: reaction found=6}}
−
* CHEMSPIDER:
+
{{#set: total reaction=8}}
−
** [http://www.chemspider.com/Chemical-Structure.395457.html 395457]
+
{{#set: completion rate=75.0}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=225237 225237]
+
−
* METABOLIGHTS : MTBLC225237
+
−
{{#set: smiles=C([N+])CC1(=CC=CC=C1)}}
+
−
{{#set: common name=2-phenylethylamine}}
+
−
{{#set: inchi key=InChIKey=BHHGXPLMPWCGHP-UHFFFAOYSA-O}}
+
−
{{#set: molecular weight=122.189    }}
+
−
{{#set: common name=β-phenylethylamine|phenylethylamine|phenethylamine}}
+
−
{{#set: consumed by=AMINEPHEN-RXN}}
+

Latest revision as of 19:47, 21 March 2018

Pathway PWY-7391

Reaction(s) found

6 reactions found over 8 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PWY-7391&oldid=43755"