Difference between revisions of "RXN1G-1084"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11517 CPD-11517] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1084 RXN1G-1084] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-hydroxyacyl-[acyl-carri...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11517 CPD-11517] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1084 RXN1G-1084] ==
* smiles:
+
* direction:
** CCC=CCC4(C(=O)CCC(CCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA
+
** 3-hydroxyacyl-[acyl-carrier-protein] dehydratase
* inchi key:
+
* ec number:
** InChIKey=JZIQDJLBFKTBAK-HUKDABTFSA-J
+
** [http://enzyme.expasy.org/EC/4.2.1.59 EC-4.2.1.59]
* molecular weight:
+
** 1039.92   
+
 
* Synonym(s):
 
* Synonym(s):
** oxopentenyl-cyclopentane-octanoyl-CoA
 
** 8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoyl-CoA
 
** OPC-8:0-CoA
 
** OPC8-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-10696]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[cis-delta19-3-hydroxyC38-ACPs]][c] '''=>''' 1 [[trans-D2-cis-D19-C38-ACPs]][c] '''+''' 1 [[WATER]][c]
* [[RXN-10695]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 a cis-delta19-3-hydroxyC38:1-[acp][c] '''=>''' 1 a trans-delta2-cis-delta19-C38:2-[acp][c] '''+''' 1 H2O[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_6884]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
* [[PWYG-321]], mycolate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWYG-321 PWYG-321]
 +
** '''86''' reactions found over '''182''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237325 44237325]
+
{{#set: common name=3-hydroxyacyl-[acyl-carrier-protein] dehydratase}}
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
+
{{#set: ec number=EC-4.2.1.59}}
{{#set: common name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octanoyl-CoA}}
+
{{#set: gene associated=Tiso_gene_6884}}
{{#set: inchi key=InChIKey=JZIQDJLBFKTBAK-HUKDABTFSA-J}}
+
{{#set: in pathway=PWYG-321}}
{{#set: molecular weight=1039.92    }}
+
{{#set: reconstruction category=annotation}}
{{#set: common name=oxopentenyl-cyclopentane-octanoyl-CoA|8-[(1R,2R)-3-oxo-2-{(Z)-pent-2-enyl}cyclopentyl]octanoyl-CoA|OPC-8:0-CoA|OPC8-CoA}}
+
{{#set: reconstruction source=annotation-experimental_annotation}}
{{#set: consumed by=RXN-10696}}
+
{{#set: reconstruction tool=pathwaytools}}
{{#set: produced by=RXN-10695}}
+

Latest revision as of 19:47, 21 March 2018

Reaction RXN1G-1084

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-hydroxyacyl-[acyl-carrier-protein] dehydratase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWYG-321, mycolate biosynthesis: PWYG-321
    • 86 reactions found over 182 reactions in the full pathway

Reconstruction information

External links

"3-hydroxyacyl-[acyl-carrier-protein] dehydratase" cannot be used as a page name in this wiki.