Difference between revisions of "N-ACETYL-NEURAMINATE-9P"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1G-1084 RXN1G-1084] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-hydroxyacyl-[acyl-carri...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-NEURAMINATE-9P N-ACETYL-NEURAMINATE-9P] == * smiles: ** CC(=O)NC1(C(CC(C([O-])=O)(O)O[...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-NEURAMINATE-9P N-ACETYL-NEURAMINATE-9P] == |
− | * | + | * smiles: |
− | ** | + | ** CC(=O)NC1(C(CC(C([O-])=O)(O)O[CH]1C(O)C(O)COP([O-])([O-])=O)O) |
* common name: | * common name: | ||
− | ** | + | ** N-acetyl-β-neuraminate 9-phosphate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=SQMNIXJSBCSNCI-PFQGKNLYSA-K |
+ | * molecular weight: | ||
+ | ** 386.229 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** N-acetyl-β-neuraminate-9-P | ||
+ | ** N-acetyl-β-neuraminic acid 9-phosphate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[RXN-9988]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | + | * LIGAND-CPD: | |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06241 C06241] |
− | {{#set: | + | * HMDB : HMDB04381 |
− | {{#set: | + | * CHEBI: |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27438 27438] | |
− | {{#set: | + | * METABOLIGHTS : MTBLC27438 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658964 90658964] |
+ | {{#set: smiles=CC(=O)NC1(C(CC(C([O-])=O)(O)O[CH]1C(O)C(O)COP([O-])([O-])=O)O)}} | ||
+ | {{#set: common name=N-acetyl-β-neuraminate 9-phosphate}} | ||
+ | {{#set: inchi key=InChIKey=SQMNIXJSBCSNCI-PFQGKNLYSA-K}} | ||
+ | {{#set: molecular weight=386.229 }} | ||
+ | {{#set: common name=N-acetyl-β-neuraminate-9-P|N-acetyl-β-neuraminic acid 9-phosphate}} | ||
+ | {{#set: produced by=RXN-9988}} |
Latest revision as of 20:48, 21 March 2018
Contents
Metabolite N-ACETYL-NEURAMINATE-9P
- smiles:
- CC(=O)NC1(C(CC(C([O-])=O)(O)O[CH]1C(O)C(O)COP([O-])([O-])=O)O)
- common name:
- N-acetyl-β-neuraminate 9-phosphate
- inchi key:
- InChIKey=SQMNIXJSBCSNCI-PFQGKNLYSA-K
- molecular weight:
- 386.229
- Synonym(s):
- N-acetyl-β-neuraminate-9-P
- N-acetyl-β-neuraminic acid 9-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=O)NC1(C(CC(C([O-])=O)(O)O[CH]1C(O)C(O)COP([O-])([O-])=O)O)" cannot be used as a page name in this wiki.