Difference between revisions of "PWY-6910"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7196 CPD-7196] == * smiles: ** CC(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))=CC=CC=C(C)C=CC=C...")
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6910 PWY-6910] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Pathway]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7196 CPD-7196] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6910 PWY-6910] ==
* smiles:
+
* taxonomic range:
** CC(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))=CC=CC=C(C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4)
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-33090]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-4751 TAX-4751]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
 +
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
 
* common name:
 
* common name:
** 9-cis-violaxanthin
+
** hydroxymethylpyrimidine salvage
* inchi key:
+
** InChIKey=SZCBXWMUOPQSOX-NLNQYMAJSA-N
+
* molecular weight:
+
** 600.88   
+
 
* Synonym(s):
 
* Synonym(s):
** 9-c-violaxanthin
+
** HMP salvage
** 9cViol
+
  
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
* [[RXN-7974]]
+
'''1''' reactions found over '''2''' reactions in the full pathway
== Reaction(s) known to produce the compound ==
+
* [[PYRIMSYN3-RXN]]
== Reaction(s) of unknown directionality ==
+
** 4 associated gene(s):
 +
*** [[Tiso_gene_2159]]
 +
*** [[Tiso_gene_16224]]
 +
*** [[Tiso_gene_17192]]
 +
*** [[Tiso_gene_2160]]
 +
** 3 reconstruction source(s) associated:
 +
*** [[orthology-athaliana]]
 +
*** [[annotation-in-silico_annotation]]
 +
*** [[orthology-esiliculosus]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=OHMETPYRKIN-RXN OHMETPYRKIN-RXN]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* ECOCYC:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5282218 5282218]
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY-6910 PWY-6910]
* CHEBI:
+
{{#set: taxonomic range=TAX-33090}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=35305 35305]
+
{{#set: taxonomic range=TAX-4751}}
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-2157}}
** [http://www.genome.jp/dbget-bin/www_bget?C13433 C13433]
+
{{#set: taxonomic range=TAX-2}}
{{#set: smiles=CC(C=CC=C(C)C=CC12(C(C)(C)CC(O)CC(O1)(C)2))=CC=CC=C(C)C=CC=C(C)C=CC34(C(C)(C)CC(O)CC(O3)(C)4)}}
+
{{#set: common name=hydroxymethylpyrimidine salvage}}
{{#set: common name=9-cis-violaxanthin}}
+
{{#set: common name=HMP salvage}}
{{#set: inchi key=InChIKey=SZCBXWMUOPQSOX-NLNQYMAJSA-N}}
+
{{#set: reaction found=1}}
{{#set: molecular weight=600.88    }}
+
{{#set: total reaction=2}}
{{#set: common name=9-c-violaxanthin|9cViol}}
+
{{#set: completion rate=50.0}}
{{#set: consumed by=RXN-7974}}
+

Latest revision as of 19:48, 21 March 2018

Pathway PWY-6910

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links