Difference between revisions of "CPD-7280"
From metabolic_network
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6910 PWY-6910] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-33090 TAX-3...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7280 CPD-7280] == * smiles: ** CC(C=CC=C(C)C=CC12(OC(CC(O)CC(C)(C)1)2))=CC=CC=C(C)CC=O * co...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7280 CPD-7280] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C=CC=C(C)C=CC12(OC(CC(O)CC(C)(C)1)2))=CC=CC=C(C)CC=O |
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** (3S,5R,6S)-5,6-epoxy-3-hydroxy-5,6-dihydro-12'-apo-β-caroten-12'-al |
| + | * inchi key: | ||
| + | ** InChIKey=FYYDCJDEFSYVOY-WENURHBKSA-N | ||
| + | * molecular weight: | ||
| + | ** 382.542 | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | == Reaction(s) | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN-7974]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == Reaction(s) | + | |
| − | + | ||
== External links == | == External links == | ||
| − | * | + | * PUBCHEM: |
| − | ** [http:// | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246021 25246021] |
| − | {{#set: | + | {{#set: smiles=CC(C=CC=C(C)C=CC12(OC(CC(O)CC(C)(C)1)2))=CC=CC=C(C)CC=O}} |
| − | + | {{#set: common name=(3S,5R,6S)-5,6-epoxy-3-hydroxy-5,6-dihydro-12'-apo-β-caroten-12'-al}} | |
| − | + | {{#set: inchi key=InChIKey=FYYDCJDEFSYVOY-WENURHBKSA-N}} | |
| − | + | {{#set: molecular weight=382.542 }} | |
| − | + | {{#set: produced by=RXN-7974}} | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:48, 21 March 2018
Contents
Metabolite CPD-7280
- smiles:
- CC(C=CC=C(C)C=CC12(OC(CC(O)CC(C)(C)1)2))=CC=CC=C(C)CC=O
- common name:
- (3S,5R,6S)-5,6-epoxy-3-hydroxy-5,6-dihydro-12'-apo-β-caroten-12'-al
- inchi key:
- InChIKey=FYYDCJDEFSYVOY-WENURHBKSA-N
- molecular weight:
- 382.542
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
