Difference between revisions of "CPD-7279"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_3577 == * right end position: ** 10364 * transcription direction: ** POSITIVE * left end position: ** 8361 * centisome position: ** 50.8793...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7279 CPD-7279] == * smiles: ** CC(C=CC12(C(CC(CC1(C)O2)O)(C)C))=CC=O * common name: ** 2-ci...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7279 CPD-7279] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C=CC12(C(CC(CC1(C)O2)O)(C)C))=CC=O |
| − | * | + | * common name: |
| − | ** | + | ** 2-cis,4-trans-xanthoxin |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=ZTALKMXOHWQNIA-HLJJCREZSA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 250.337 |
* Synonym(s): | * Synonym(s): | ||
| + | ** xanthoxin | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN-7973]] |
| − | + | * [[RXN-7974]] | |
| − | * | + | * [[RXN-698]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91820570 91820570] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.4445403.html 4445403] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32304 32304] |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C13453 C13453] | ||
| + | {{#set: smiles=CC(C=CC12(C(CC(CC1(C)O2)O)(C)C))=CC=O}} | ||
| + | {{#set: common name=2-cis,4-trans-xanthoxin}} | ||
| + | {{#set: inchi key=InChIKey=ZTALKMXOHWQNIA-HLJJCREZSA-N}} | ||
| + | {{#set: molecular weight=250.337 }} | ||
| + | {{#set: common name=xanthoxin}} | ||
| + | {{#set: produced by=RXN-7973|RXN-7974|RXN-698}} | ||
Latest revision as of 20:48, 21 March 2018
Contents
Metabolite CPD-7279
- smiles:
- CC(C=CC12(C(CC(CC1(C)O2)O)(C)C))=CC=O
- common name:
- 2-cis,4-trans-xanthoxin
- inchi key:
- InChIKey=ZTALKMXOHWQNIA-HLJJCREZSA-N
- molecular weight:
- 250.337
- Synonym(s):
- xanthoxin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
