Difference between revisions of "RXN-13671"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALTOTRIOSE MALTOTRIOSE] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)OC3(C(OC(C(C3O)O)...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13671 RXN-13671] == * direction: ** REVERSIBLE * common name: ** ORF * ec number: ** [http://en...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MALTOTRIOSE MALTOTRIOSE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13671 RXN-13671] ==
−
* smiles:
+
* direction:
−
** C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)OC3(C(OC(C(C3O)O)O)CO))CO)))O
+
** REVERSIBLE
 
* common name:
 
* common name:
−
** maltotriose
+
** ORF
−
* inchi key:
+
* ec number:
−
** InChIKey=FYGDTMLNYKFZSV-DZOUCCHMSA-N
+
** [http://enzyme.expasy.org/EC/1.2.1.10 EC-1.2.1.10]
−
* molecular weight:
+
−
** 504.441   
+
 
* Synonym(s):
 
* Synonym(s):
−
** amylotriose
 
−
** α-D-glucopyranosyl-(1→4)-α-D-glucopyranosyl-(1→4)-D-glucose
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN0-5183]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-7000]][c] '''+''' 1 [[NAD]][c] '''+''' 1 [[CO-A]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[ISOBUTYRYL-COA]][c]
−
* [[RXN0-5182]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 isobutanal[c] '''+''' 1 NAD+[c] '''+''' 1 coenzyme A[c] '''<=>''' 1 H+[c] '''+''' 1 NADH[c] '''+''' 1 isobutanoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_7649]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 1109-28-0
+
{{#set: direction=REVERSIBLE}}
−
* PUBCHEM:
+
{{#set: common name=ORF}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439586 439586]
+
{{#set: ec number=EC-1.2.1.10}}
−
* HMDB : HMDB01262
+
{{#set: gene associated=Tiso_gene_7649}}
−
* LIGAND-CPD:
+
{{#set: in pathway=}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01835 C01835]
+
{{#set: reconstruction category=annotation}}
−
* CHEMSPIDER:
+
{{#set: reconstruction source=annotation-in-silico_annotation}}
−
** [http://www.chemspider.com/Chemical-Structure.388669.html 388669]
+
{{#set: reconstruction tool=pathwaytools}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61993 61993]
+
−
* BIGG : malttr
+
−
{{#set: smiles=C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)OC3(C(OC(C(C3O)O)O)CO))CO)))O}}
+
−
{{#set: common name=maltotriose}}
+
−
{{#set: inchi key=InChIKey=FYGDTMLNYKFZSV-DZOUCCHMSA-N}}
+
−
{{#set: molecular weight=504.441    }}
+
−
{{#set: common name=amylotriose|&alpha;-D-glucopyranosyl-(1&rarr;4)-&alpha;-D-glucopyranosyl-(1&rarr;4)-D-glucose}}
+
−
{{#set: consumed by=RXN0-5183}}
+
−
{{#set: produced by=RXN0-5182}}
+

Latest revision as of 19:48, 21 March 2018

Reaction RXN-13671

  • direction:
    • REVERSIBLE
  • common name:
    • ORF
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 isobutanal[c] + 1 NAD+[c] + 1 coenzyme A[c] <=> 1 H+[c] + 1 NADH[c] + 1 isobutanoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-13671&oldid=43870"