Difference between revisions of "L-ASPARTATE-SEMIALDEHYDE"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-707 RXN-707] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/1.3....") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE-SEMIALDEHYDE L-ASPARTATE-SEMIALDEHYDE] == * smiles: ** [CH](=O)CC([N+])C(=O)[O-] *...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-ASPARTATE-SEMIALDEHYDE L-ASPARTATE-SEMIALDEHYDE] == |
− | * | + | * smiles: |
− | ** | + | ** [CH](=O)CC([N+])C(=O)[O-] |
− | * | + | * common name: |
− | ** | + | ** L-aspartate-semialdehyde |
+ | * inchi key: | ||
+ | ** InChIKey=HOSWPDPVFBCLSY-VKHMYHEASA-N | ||
+ | * molecular weight: | ||
+ | ** 117.104 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** L-aspartic 4-semialdehyde | ||
+ | ** L-aspartate-4-semialdehyde | ||
+ | ** L-aspartate β-semialdehyde | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | * | + | * [[R02292]] |
− | + | * [[HOMOSERDEHYDROG-RXN]] | |
− | * | + | * [[R01775]] |
− | + | * [[DIHYDRODIPICSYN-RXN]] | |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN]] | |
− | * | + | |
− | * | + | |
− | == | + | |
− | + | ||
− | + | ||
− | = | + | |
− | * | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 15106-57-7 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5287708 5287708] |
− | {{#set: | + | * HMDB : HMDB12249 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00441 C00441] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=537519 537519] | ||
+ | * BIGG : aspsa | ||
+ | {{#set: smiles=[CH](=O)CC([N+])C(=O)[O-]}} | ||
+ | {{#set: common name=L-aspartate-semialdehyde}} | ||
+ | {{#set: inchi key=InChIKey=HOSWPDPVFBCLSY-VKHMYHEASA-N}} | ||
+ | {{#set: molecular weight=117.104 }} | ||
+ | {{#set: common name=L-aspartic 4-semialdehyde|L-aspartate-4-semialdehyde|L-aspartate β-semialdehyde}} | ||
+ | {{#set: consumed by=R02292|HOMOSERDEHYDROG-RXN|R01775|DIHYDRODIPICSYN-RXN}} | ||
+ | {{#set: reversible reaction associated=ASPARTATE-SEMIALDEHYDE-DEHYDROGENASE-RXN}} |
Latest revision as of 19:49, 21 March 2018
Contents
Metabolite L-ASPARTATE-SEMIALDEHYDE
- smiles:
- [CH](=O)CC([N+])C(=O)[O-]
- common name:
- L-aspartate-semialdehyde
- inchi key:
- InChIKey=HOSWPDPVFBCLSY-VKHMYHEASA-N
- molecular weight:
- 117.104
- Synonym(s):
- L-aspartic 4-semialdehyde
- L-aspartate-4-semialdehyde
- L-aspartate β-semialdehyde
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)CC([N+])C(=O)[O-" cannot be used as a page name in this wiki.