Difference between revisions of "Glutamine-synthetase-adenylyl-Tyr"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13792 CPD-13792] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCCCCCC(=O)[O-] * common name: ** (7Z,...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Glutamine-synthetase-adenylyl-Tyr Glutamine-synthetase-adenylyl-Tyr] == * common name: ** a [gl...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Glutamine-synthetase-adenylyl-Tyr Glutamine-synthetase-adenylyl-Tyr] == |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** a [glutamine synthetase]-O4-(5'-adenylyl)-L-tyrosine |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[GSADENYLATION-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | + | {{#set: common name=a [glutamine synthetase]-O4-(5'-adenylyl)-L-tyrosine}} | |
− | + | {{#set: produced by=GSADENYLATION-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: produced by= | + |
Latest revision as of 19:52, 21 March 2018
Contents
Metabolite Glutamine-synthetase-adenylyl-Tyr
- common name:
- a [glutamine synthetase]-O4-(5'-adenylyl)-L-tyrosine
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a [glutamine synthetase]-O4-(5'-adenylyl)-L-tyrosine" cannot be used as a page name in this wiki.