Difference between revisions of "RXN-17022"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOYLSUCCINYL-COA BENZOYLSUCCINYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C(C(=O...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17022 RXN-17022] == * direction: ** LEFT-TO-RIGHT * common name: ** 1-acylglycerol-3-phosphate_...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BENZOYLSUCCINYL-COA BENZOYLSUCCINYL-COA] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-17022 RXN-17022] ==
−
* smiles:
+
* direction:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C(C(=O)C1(=CC=CC=C1))CC(=O)[O-])COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** benzoylsuccinyl-CoA
+
** 1-acylglycerol-3-phosphate_o-acyltransferase
−
* inchi key:
+
* ec number:
−
** InChIKey=SGNPJINSCKFITG-IHEBCORQSA-I
+
** [http://enzyme.expasy.org/EC/2.3.1.51 EC-2.3.1.51]
−
* molecular weight:
+
−
** 966.676   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-905]]
+
** 1 [[Myristoyl-ACPs]][c] '''+''' 1 [[CPD-18379]][c] '''=>''' 1 [[ACP]][c] '''+''' 1 [[CPD0-1425]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a myristoyl-[acp][c] '''+''' 1 1-myristoylglycerol 3-phosphate[c] '''=>''' 1 a holo-[acyl-carrier protein][c] '''+''' 1 dimyristoyl phosphatidate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_13959]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659089 90659089]
+
{{#set: common name=1-acylglycerol-3-phosphate_o-acyltransferase}}
−
* CHEBI:
+
{{#set: ec number=EC-2.3.1.51}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28882 28882]
+
{{#set: gene associated=Tiso_gene_13959}}
−
* LIGAND-CPD:
+
{{#set: in pathway=}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C09820 C09820]
+
{{#set: reconstruction category=annotation}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C(C(=O)C1(=CC=CC=C1))CC(=O)[O-])COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
−
{{#set: common name=benzoylsuccinyl-CoA}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: inchi key=InChIKey=SGNPJINSCKFITG-IHEBCORQSA-I}}
+
−
{{#set: molecular weight=966.676    }}
+
−
{{#set: produced by=RXN-905}}
+

Latest revision as of 20:52, 21 March 2018

Reaction RXN-17022

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 1-acylglycerol-3-phosphate_o-acyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 a myristoyl-[acp][c] + 1 1-myristoylglycerol 3-phosphate[c] => 1 a holo-[acyl-carrier protein][c] + 1 dimyristoyl phosphatidate[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-17022&oldid=44343"