Difference between revisions of "5-Phospho-RNA"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OLEATE-CPD OLEATE-CPD] == * smiles: ** CCCCCCCCC=CCCCCCCCC([O-])=O * common name: ** oleate * i...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-Phospho-RNA 5-Phospho-RNA] == * common name: ** a 5'-phospho-ribonucleoside-[RNA] * Synonym(s...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-Phospho-RNA 5-Phospho-RNA] == |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a 5'-phospho-ribonucleoside-[RNA] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** an RNA with a 5'-monophosphate |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-17926]] |
| − | * [[ | + | * [[RNA-LIGASE-ATP-RXN]] |
| − | + | ||
| − | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a 5'-phospho-ribonucleoside-[RNA]}} | |
| − | + | {{#set: common name=an RNA with a 5'-monophosphate}} | |
| − | + | {{#set: consumed by=RXN-17926|RNA-LIGASE-ATP-RXN}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: consumed by=RXN- | + | |
| − | + | ||
Latest revision as of 19:55, 21 March 2018
Contents
Metabolite 5-Phospho-RNA
- common name:
- a 5'-phospho-ribonucleoside-[RNA]
- Synonym(s):
- an RNA with a 5'-monophosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a 5'-phospho-ribonucleoside-[RNA" cannot be used as a page name in this wiki.
