Difference between revisions of "Tiso gene 5715"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16825 CPD-16825] == * smiles: ** C1(C=C(C=C2(OCC(CC=12)C3(C=CC(=CC=3)OS([O-])(=O)=O)))O) *...")
(Created page with "Category:Gene == Gene Tiso_gene_5715 == * right end position: ** 12421 * transcription direction: ** POSITIVE * left end position: ** 10289 * centisome position: ** 78.885...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16825 CPD-16825] ==
+
== Gene Tiso_gene_5715 ==
−
* smiles:
+
* right end position:
−
** C1(C=C(C=C2(OCC(CC=12)C3(C=CC(=CC=3)OS([O-])(=O)=O)))O)
+
** 12421
−
* common name:
+
* transcription direction:
−
** (S)-equol 4'-sulfate
+
** POSITIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=UXOJWGSGKUYMIA-GFCCVEGCSA-M
+
** 10289
−
* molecular weight:
+
* centisome position:
−
** 321.324    
+
** 78.88523    
 
* Synonym(s):
 
* Synonym(s):
−
** 4',7-isoflavandiol 4'-sulfate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[3.4.11.18-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-15589]]
+
*** Assignment: automated-name-match
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: automated-name-match
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[RXN-17873]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-17874]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-17875]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-17876]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-17877]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: automated-name-match
 +
* Reaction: [[RXN-17878]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-7799]]
 +
* [[PWY-7800]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=12421}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=29979373 29979373]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=C1(C=C(C=C2(OCC(CC=12)C3(C=CC(=CC=3)OS([O-])(=O)=O)))O)}}
+
{{#set: left end position=10289}}
−
{{#set: common name=(S)-equol 4'-sulfate}}
+
{{#set: centisome position=78.88523   }}
−
{{#set: inchi key=InChIKey=UXOJWGSGKUYMIA-GFCCVEGCSA-M}}
+
{{#set: reaction associated=3.4.11.18-RXN|RXN-17873|RXN-17874|RXN-17875|RXN-17876|RXN-17877|RXN-17878}}
−
{{#set: molecular weight=321.324   }}
+
{{#set: pathway associated=PWY-7799|PWY-7800}}
−
{{#set: common name=4',7-isoflavandiol 4'-sulfate}}
+
−
{{#set: reversible reaction associated=RXN-15589}}
+

Latest revision as of 20:55, 21 March 2018

Gene Tiso_gene_5715

  • right end position:
    • 12421
  • transcription direction:
    • POSITIVE
  • left end position:
    • 10289
  • centisome position:
    • 78.88523
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_5715&oldid=44668"