Difference between revisions of "Tiso gene 15839"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8610 CPD-8610] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C...")
(Created page with "Category:Gene == Gene Tiso_gene_15839 == * right end position: ** 4007 * transcription direction: ** NEGATIVE * left end position: ** 2153 * centisome position: ** 45.1457...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8610 CPD-8610] ==
+
== Gene Tiso_gene_15839 ==
* smiles:
+
* right end position:
** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
+
** 4007
* common name:
+
* transcription direction:
** 4,4-dimethyl-5α-cholesta-8-en-3-β-ol
+
** NEGATIVE
* inchi key:
+
* left end position:
** InChIKey=FYHRVINOXYETMN-QGBOJXOESA-N
+
** 2153
* molecular weight:
+
* centisome position:
** 414.713    
+
** 45.145733    
 
* Synonym(s):
 
* Synonym(s):
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PRTRANS-RXN]]
* [[RXN66-14]]
+
** Source: [[annotation-in-silico_annotation]]
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways associated ==
 +
* [[TRPSYN-PWY]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: right end position=4007}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12070223 12070223]
+
{{#set: transcription direction=NEGATIVE}}
* CHEMSPIDER:
+
{{#set: left end position=2153}}
** [http://www.chemspider.com/Chemical-Structure.10474091.html 10474091]
+
{{#set: centisome position=45.145733    }}
* HMDB : HMDB06840
+
{{#set: reaction associated=PRTRANS-RXN}}
* LIGAND-CPD:
+
{{#set: pathway associated=TRPSYN-PWY}}
** [http://www.genome.jp/dbget-bin/www_bget?C15915 C15915]
+
{{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}}
+
{{#set: common name=4,4-dimethyl-5α-cholesta-8-en-3-β-ol}}
+
{{#set: inchi key=InChIKey=FYHRVINOXYETMN-QGBOJXOESA-N}}
+
{{#set: molecular weight=414.713    }}
+
{{#set: produced by=RXN66-14}}
+

Latest revision as of 19:55, 21 March 2018

Gene Tiso_gene_15839

  • right end position:
    • 4007
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 2153
  • centisome position:
    • 45.145733
  • Synonym(s):

Reactions associated

Pathways associated

External links