Difference between revisions of "CPD-8564"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.5.1.19-RXN 2.5.1.19-RXN] == * direction: ** REVERSIBLE * common name: ** pentafunctional_protein...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8564 CPD-8564] == * smiles: ** C(O)C(C(=O)N[R])NC(=O)[R] * common name: ** myosin light-cha...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=2.5.1.19-RXN 2.5.1.19-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8564 CPD-8564] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C(O)C(C(=O)N[R])NC(=O)[R]
 
* common name:
 
* common name:
−
** pentafunctional_protein
+
** myosin light-chain
−
* ec number:
+
−
** [http://enzyme.expasy.org/EC/2.5.1.19 EC-2.5.1.19]
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[PHOSPHO-ENOL-PYRUVATE]][c] '''+''' 1 [[SHIKIMATE-5P]][c] '''<=>''' 1 [[Pi]][c] '''+''' 1 [[3-ENOLPYRUVYL-SHIKIMATE-5P]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[2.7.11.18-RXN]]
−
** 1 phosphoenolpyruvate[c] '''+''' 1 shikimate 3-phosphate[c] '''<=>''' 1 phosphate[c] '''+''' 1 5-enolpyruvoyl-shikimate 3-phosphate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_5753]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
** Source: [[orthology-athaliana]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
* Gene: [[Tiso_gene_5752]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-6163]], chorismate biosynthesis from 3-dehydroquinate: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6163 PWY-6163]
+
−
** '''6''' reactions found over '''6''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-athaliana]]
+
−
*** Tool: [[pantograph]]
+
−
** Source: [[orthology-creinhardtii]]
+
−
*** Tool: [[pantograph]]
+
−
* Category: [[manual]]
+
−
** Source: [[manual-primary_network]]
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* LIGAND-CPD:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=21256 21256]
+
** [http://www.genome.jp/dbget-bin/www_bget?C01003 C01003]
−
* LIGAND-RXN:
+
{{#set: smiles=C(O)C(C(=O)N[R])NC(=O)[R]}}
−
** [http://www.genome.jp/dbget-bin/www_bget?R03460 R03460]
+
{{#set: common name=myosin light-chain}}
−
* UNIPROT:
+
{{#set: reversible reaction associated=2.7.11.18-RXN}}
−
** [http://www.uniprot.org/uniprot/P22299 P22299]
+
−
** [http://www.uniprot.org/uniprot/P07547 P07547]
+
−
** [http://www.uniprot.org/uniprot/P08566 P08566]
+
−
** [http://www.uniprot.org/uniprot/P22487 P22487]
+
−
** [http://www.uniprot.org/uniprot/P52312 P52312]
+
−
** [http://www.uniprot.org/uniprot/Q9JTT3 Q9JTT3]
+
−
** [http://www.uniprot.org/uniprot/Q03421 Q03421]
+
−
** [http://www.uniprot.org/uniprot/P19786 P19786]
+
−
** [http://www.uniprot.org/uniprot/P17688 P17688]
+
−
** [http://www.uniprot.org/uniprot/P24497 P24497]
+
−
** [http://www.uniprot.org/uniprot/P23981 P23981]
+
−
** [http://www.uniprot.org/uniprot/P23281 P23281]
+
−
** [http://www.uniprot.org/uniprot/Q04570 Q04570]
+
−
** [http://www.uniprot.org/uniprot/P43905 P43905]
+
−
** [http://www.uniprot.org/uniprot/Q59975 Q59975]
+
−
** [http://www.uniprot.org/uniprot/P12421 P12421]
+
−
** [http://www.uniprot.org/uniprot/P07637 P07637]
+
−
** [http://www.uniprot.org/uniprot/P19688 P19688]
+
−
** [http://www.uniprot.org/uniprot/P0A6D3 P0A6D3]
+
−
** [http://www.uniprot.org/uniprot/P11043 P11043]
+
−
{{#set: direction=REVERSIBLE}}
+
−
{{#set: common name=pentafunctional_protein}}
+
−
{{#set: ec number=EC-2.5.1.19}}
+
−
{{#set: gene associated=Tiso_gene_5753|Tiso_gene_5752}}
+
−
{{#set: in pathway=PWY-6163}}
+
−
{{#set: reconstruction category=orthology|manual|annotation}}
+
−
{{#set: reconstruction source=orthology-creinhardtii|orthology-athaliana|annotation-in-silico_annotation|manual-primary_network}}
+
−
{{#set: reconstruction tool=pantograph|pathwaytools}}
+

Latest revision as of 19:56, 21 March 2018

Metabolite CPD-8564

  • smiles:
    • C(O)C(C(=O)N[R])NC(=O)[R]
  • common name:
    • myosin light-chain
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C(C(=O)N[R])NC(=O)[R" cannot be used as a page name in this wiki.


Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-8564&oldid=44746"