Difference between revisions of "FPPSYN-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9924 CPD-9924] == * smiles: ** C=C(C(=O)[O-])OC1(CC=C(C(=O)CCC(=O)[O-])C(C(O)1)C(=O)[O-]) *...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FPPSYN-RXN FPPSYN-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/E...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FPPSYN-RXN FPPSYN-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | * | + | * ec number: |
− | ** 2 | + | ** [http://enzyme.expasy.org/EC/2.5.1.10 EC-2.5.1.10] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[DELTA3-ISOPENTENYL-PP]][c] '''+''' 1 [[GERANYL-PP]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[FARNESYL-PP]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 isopentenyl diphosphate[c] '''+''' 1 geranyl diphosphate[c] '''=>''' 1 diphosphate[c] '''+''' 1 (2E,6E)-farnesyl diphosphate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_16284]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-7736]], stellatic acid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7736 PWY-7736] | ||
+ | ** '''3''' reactions found over '''8''' reactions in the full pathway | ||
+ | * [[PWY-7721]], methyl phomopsenoate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7721 PWY-7721] | ||
+ | ** '''2''' reactions found over '''4''' reactions in the full pathway | ||
+ | * [[PWY-5123]], trans, trans-farnesyl diphosphate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5123 PWY-5123] | ||
+ | ** '''3''' reactions found over '''3''' reactions in the full pathway | ||
+ | * [[PWY-7102]], bisabolene biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7102 PWY-7102] | ||
+ | ** '''3''' reactions found over '''6''' reactions in the full pathway | ||
+ | * [[PWY-6859]], all-trans-farnesol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6859 PWY-6859] | ||
+ | ** '''3''' reactions found over '''4''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[manual]] | ||
+ | ** Source: [[manual-primary_network]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http:// | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19361 19361] |
− | * | + | * LIGAND-RXN: |
− | ** [http://www. | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02003 R02003] |
− | * | + | * UNIPROT: |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P08524 P08524] |
− | + | ** [http://www.uniprot.org/uniprot/P05369 P05369] | |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P14324 P14324] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9CH81 Q9CH81] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9PM32 Q9PM32] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P45204 P45204] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/Q9JSM0 Q9JSM0] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P49350 P49350] |
+ | ** [http://www.uniprot.org/uniprot/P22939 P22939] | ||
+ | ** [http://www.uniprot.org/uniprot/Q08291 Q08291] | ||
+ | ** [http://www.uniprot.org/uniprot/P49349 P49349] | ||
+ | ** [http://www.uniprot.org/uniprot/Q09152 Q09152] | ||
+ | ** [http://www.uniprot.org/uniprot/P49351 P49351] | ||
+ | ** [http://www.uniprot.org/uniprot/P49352 P49352] | ||
+ | ** [http://www.uniprot.org/uniprot/Q43315 Q43315] | ||
+ | ** [http://www.uniprot.org/uniprot/O24241 O24241] | ||
+ | ** [http://www.uniprot.org/uniprot/O24242 O24242] | ||
+ | ** [http://www.uniprot.org/uniprot/Q92334 Q92334] | ||
+ | ** [http://www.uniprot.org/uniprot/Q92218 Q92218] | ||
+ | ** [http://www.uniprot.org/uniprot/Q92235 Q92235] | ||
+ | ** [http://www.uniprot.org/uniprot/Q92250 Q92250] | ||
+ | ** [http://www.uniprot.org/uniprot/Q8L7F4 Q8L7F4] | ||
+ | ** [http://www.uniprot.org/uniprot/P49353 P49353] | ||
+ | ** [http://www.uniprot.org/uniprot/O04882 O04882] | ||
+ | ** [http://www.uniprot.org/uniprot/O65004 O65004] | ||
+ | ** [http://www.uniprot.org/uniprot/O14230 O14230] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: ec number=EC-2.5.1.10}} | ||
+ | {{#set: gene associated=Tiso_gene_16284}} | ||
+ | {{#set: in pathway=PWY-7736|PWY-7721|PWY-5123|PWY-7102|PWY-6859}} | ||
+ | {{#set: reconstruction category=orthology|manual}} | ||
+ | {{#set: reconstruction source=orthology-athaliana|manual-primary_network|orthology-esiliculosus|orthology-synechocystis}} | ||
+ | {{#set: reconstruction tool=pantograph}} |
Latest revision as of 19:56, 21 March 2018
Contents
Reaction FPPSYN-RXN
- direction:
- LEFT-TO-RIGHT
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 DELTA3-ISOPENTENYL-PP[c] + 1 GERANYL-PP[c] => 1 PPI[c] + 1 FARNESYL-PP[c]
- With common name(s):
- 1 isopentenyl diphosphate[c] + 1 geranyl diphosphate[c] => 1 diphosphate[c] + 1 (2E,6E)-farnesyl diphosphate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_16284
- Source: orthology-athaliana
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
Pathways
- PWY-7736, stellatic acid biosynthesis: PWY-7736
- 3 reactions found over 8 reactions in the full pathway
- PWY-7721, methyl phomopsenoate biosynthesis: PWY-7721
- 2 reactions found over 4 reactions in the full pathway
- PWY-5123, trans, trans-farnesyl diphosphate biosynthesis: PWY-5123
- 3 reactions found over 3 reactions in the full pathway
- PWY-7102, bisabolene biosynthesis (engineered): PWY-7102
- 3 reactions found over 6 reactions in the full pathway
- PWY-6859, all-trans-farnesol biosynthesis: PWY-6859
- 3 reactions found over 4 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-synechocystis
- Tool: pantograph
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-athaliana
- Category: manual
- Source: manual-primary_network
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: