Difference between revisions of "CPD-8620"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_10528 == * right end position: ** 8404 * transcription direction: ** POSITIVE * left end position: ** 5895 * centisome position: ** 69.7055...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8620 CPD-8620] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8620 CPD-8620] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C |
| − | * | + | * common name: |
| − | ** | + | ** 5α-cholesta-8-en-3-one |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=RZSXSHNNQBIPTL-ZSBATXSLSA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 384.644 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN66-23]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44263324 44263324] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=87056 87056] |
| − | {{#set: | + | * HMDB : HMDB12178 |
| − | {{#set: | + | {{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C}} |
| + | {{#set: common name=5α-cholesta-8-en-3-one}} | ||
| + | {{#set: inchi key=InChIKey=RZSXSHNNQBIPTL-ZSBATXSLSA-N}} | ||
| + | {{#set: molecular weight=384.644 }} | ||
| + | {{#set: produced by=RXN66-23}} | ||
Latest revision as of 20:56, 21 March 2018
Contents
Metabolite CPD-8620
- smiles:
- CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C
- common name:
- 5α-cholesta-8-en-3-one
- inchi key:
- InChIKey=RZSXSHNNQBIPTL-ZSBATXSLSA-N
- molecular weight:
- 384.644
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)CC(=O)CC3)))CC4)))C" cannot be used as a page name in this wiki.
