Difference between revisions of "CPD-236"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_8934 == * right end position: ** 8174 * transcription direction: ** NEGATIVE * left end position: ** 5389 * centisome position: ** 55.18124...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-236 CPD-236] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-236 CPD-236] == |
| − | * | + | * smiles: |
| − | ** | + | ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O))) |
| − | * | + | * common name: |
| − | ** | + | ** gibberellin A29 |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=BKBYHSYZKIAJDA-LPEMZMRWSA-M |
| − | * | + | * molecular weight: |
| − | ** | + | ** 347.387 |
* Synonym(s): | * Synonym(s): | ||
| + | ** GA29 | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN-113]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200412 25200412] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28040 28040] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06096 C06096] |
| + | {{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))}} | ||
| + | {{#set: common name=gibberellin A29}} | ||
| + | {{#set: inchi key=InChIKey=BKBYHSYZKIAJDA-LPEMZMRWSA-M}} | ||
| + | {{#set: molecular weight=347.387 }} | ||
| + | {{#set: common name=GA29}} | ||
| + | {{#set: produced by=RXN-113}} | ||
Latest revision as of 19:59, 21 March 2018
Contents
Metabolite CPD-236
- smiles:
- C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))
- common name:
- gibberellin A29
- inchi key:
- InChIKey=BKBYHSYZKIAJDA-LPEMZMRWSA-M
- molecular weight:
- 347.387
- Synonym(s):
- GA29
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))" cannot be used as a page name in this wiki.
