Difference between revisions of "RXN-9868"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLUCARATE D-GLUCARATE] == * smiles: ** C(=O)(C(O)C(O)C(O)C(O)C(=O)[O-])[O-] * common name: **...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9868 RXN-9868] == * direction: ** LEFT-TO-RIGHT * common name: ** carboxymethylenebutenolidase...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9868 RXN-9868] == |
| − | * | + | * direction: |
| − | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
| − | ** | + | ** carboxymethylenebutenolidase |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/3.1.1.45 EC-3.1.1.45] |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction | + | == Reaction Formula == |
| − | = | + | * With identifiers: |
| − | == | + | ** 1 [[WATER]][c] '''+''' 1 [[CPD-10608]][c] '''=>''' 1 [[CPD-294]][c] '''+''' 1 [[PROTON]][c] |
| − | * [[ | + | * With common name(s): |
| + | ** 1 H2O[c] '''+''' 1 trans-dienelactone[c] '''=>''' 1 2-maleylacetate[c] '''+''' 1 H+[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_12835]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Assignment: AUTOMATED-NAME-MATCH | ||
| + | == Pathways == | ||
| + | * [[PWY-6089]], 3-chlorocatechol degradation I (ortho): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6089 PWY-6089] | ||
| + | ** '''1''' reactions found over '''5''' reactions in the full pathway | ||
| + | == Reconstruction information == | ||
| + | * Category: [[annotation]] | ||
| + | ** Source: [[annotation-in-silico_annotation]] | ||
| + | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
| − | + | * LIGAND-RXN: | |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?R06838 R06838] | |
| − | + | {{#set: direction=LEFT-TO-RIGHT}} | |
| − | + | {{#set: common name=carboxymethylenebutenolidase}} | |
| − | + | {{#set: ec number=EC-3.1.1.45}} | |
| − | * LIGAND- | + | {{#set: gene associated=Tiso_gene_12835}} |
| − | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: in pathway=PWY-6089}} |
| − | + | {{#set: reconstruction category=annotation}} | |
| − | + | {{#set: reconstruction source=annotation-in-silico_annotation}} | |
| − | + | {{#set: reconstruction tool=pathwaytools}} | |
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:59, 21 March 2018
Contents
Reaction RXN-9868
- direction:
- LEFT-TO-RIGHT
- common name:
- carboxymethylenebutenolidase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 H2O[c] + 1 trans-dienelactone[c] => 1 2-maleylacetate[c] + 1 H+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_12835
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
Pathways
- PWY-6089, 3-chlorocatechol degradation I (ortho): PWY-6089
- 1 reactions found over 5 reactions in the full pathway
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- LIGAND-RXN:
