Difference between revisions of "2-Hydroxy-carboxylates"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOHEME PROTOHEME] == * smiles: ** C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Hydroxy-carboxylates 2-Hydroxy-carboxylates] == * common name: ** a 2-hydroxy carboxylate * S...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOHEME PROTOHEME] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Hydroxy-carboxylates 2-Hydroxy-carboxylates] ==
* smiles:
+
** C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(C=1C=C3(C(C)=C(C=C)C(=[N+]23)C=C5(C(C)=C(CCC(=O)[O-])C(N45)=C6)))7))8))))
+
 
* common name:
 
* common name:
** ferroheme b
+
** a 2-hydroxy carboxylate
* inchi key:
+
** InChIKey=KABFMIBPWCXCRK-RGGAHWMASA-J
+
* molecular weight:
+
** 614.482   
+
 
* Synonym(s):
 
* Synonym(s):
** protoheme IX
 
** ferroprotoporphyrin IX
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
* [[HEME-OXYGENASE-DECYCLIZING-RXN]]
 
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN-7919]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[PROTOHEMEFERROCHELAT-RXN]]
 
 
== External links  ==
 
== External links  ==
* CHEBI:
+
{{#set: common name=a 2-hydroxy carboxylate}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17627 17627]
+
{{#set: produced by=RXN-7919}}
* BIGG : pheme
+
{{#set: smiles=C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(C=1C=C3(C(C)=C(C=C)C(=[N+]23)C=C5(C(C)=C(CCC(=O)[O-])C(N45)=C6)))7))8))))}}
+
{{#set: common name=ferroheme b}}
+
{{#set: inchi key=InChIKey=KABFMIBPWCXCRK-RGGAHWMASA-J}}
+
{{#set: molecular weight=614.482    }}
+
{{#set: common name=protoheme IX|ferroprotoporphyrin IX}}
+
{{#set: consumed by=HEME-OXYGENASE-DECYCLIZING-RXN}}
+
{{#set: reversible reaction associated=PROTOHEMEFERROCHELAT-RXN}}
+

Latest revision as of 20:59, 21 March 2018

Metabolite 2-Hydroxy-carboxylates

  • common name:
    • a 2-hydroxy carboxylate
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links