Difference between revisions of "Tiso gene 6521"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-DEOH-DEOXY-MANNOSE DTDP-DEOH-DEOXY-MANNOSE] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C...")
(Created page with "Category:Gene == Gene Tiso_gene_6521 == * right end position: ** 11897 * transcription direction: ** POSITIVE * left end position: ** 10978 * centisome position: ** 90.674...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-DEOH-DEOXY-MANNOSE DTDP-DEOH-DEOXY-MANNOSE] ==
+
== Gene Tiso_gene_6521 ==
−
* smiles:
+
* right end position:
−
** CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(C)C(=O)C(O)C(O)2))O3))
+
** 11897
−
* common name:
+
* transcription direction:
−
** dTDP-4-dehydro-β-L-rhamnose
+
** POSITIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=PSXWNITXWWECNY-LPVGZGSHSA-L
+
** 10978
−
* molecular weight:
+
* centisome position:
−
** 544.302    
+
** 90.67482    
 
* Synonym(s):
 
* Synonym(s):
−
** dTDP-4-oxo-6-deoxy-β-L-mannose
 
−
** dTDP-4-oxo-β-L-rhamnose
 
−
** dTDP-4-dehydro-6-deoxy-β-L-mannose
 
−
** dTDP-4-keto-L-rhamnose
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[DTDPDEHYRHAMREDUCT-RXN]]
+
* Reaction: [[RXN0-1081]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: automated-name-match
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=11897}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53356769 53356769]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: left end position=10978}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62830 62830]
+
{{#set: centisome position=90.67482   }}
−
* BIGG : dtdp4d6dm
+
{{#set: reaction associated=RXN0-1081}}
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C00688 C00688]
+
−
{{#set: smiles=CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(C)C(=O)C(O)C(O)2))O3))}}
+
−
{{#set: common name=dTDP-4-dehydro-β-L-rhamnose}}
+
−
{{#set: inchi key=InChIKey=PSXWNITXWWECNY-LPVGZGSHSA-L}}
+
−
{{#set: molecular weight=544.302   }}
+
−
{{#set: common name=dTDP-4-oxo-6-deoxy-β-L-mannose|dTDP-4-oxo-β-L-rhamnose|dTDP-4-dehydro-6-deoxy-β-L-mannose|dTDP-4-keto-L-rhamnose}}
+
−
{{#set: consumed by=DTDPDEHYRHAMREDUCT-RXN}}
+

Latest revision as of 19:59, 21 March 2018

Gene Tiso_gene_6521

  • right end position:
    • 11897
  • transcription direction:
    • POSITIVE
  • left end position:
    • 10978
  • centisome position:
    • 90.67482
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_6521&oldid=45129"