Difference between revisions of "Tiso gene 6869"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7003 CPD-7003] == * smiles: ** CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C *...")
(Created page with "Category:Gene == Gene Tiso_gene_6869 == * Synonym(s): == Reactions associated == * Reaction: 2.4.1.213-RXN ** Source: orthology-synechocystis * Reaction: TREHAL...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7003 CPD-7003] ==
+
== Gene Tiso_gene_6869 ==
* smiles:
+
** CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
+
* common name:
+
** tetrahydrogeranylgeranyl diphosphate
+
* inchi key:
+
** InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K
+
* molecular weight:
+
** 451.456   
+
 
* Synonym(s):
 
* Synonym(s):
** tetrahydroGGPP
 
** tetrahydrogeranylgeranyl pyrophosphate
 
** tetrahydrogeranylgeranyl-PP
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
== Reaction(s) known to produce the compound ==
+
* Reaction: [[2.4.1.213-RXN]]
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-synechocystis]]
* [[RXN-7659]]
+
* Reaction: [[TREHALOSE6PSYN-RXN]]
* [[RXN-7660]]
+
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: automated-name-match
 +
== Pathways associated ==
 +
* [[TRESYN-PWY]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=2.4.1.213-RXN|TREHALOSE6PSYN-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657275 90657275]
+
{{#set: pathway associated=TRESYN-PWY}}
{{#set: smiles=CC(=CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C}}
+
{{#set: common name=tetrahydrogeranylgeranyl diphosphate}}
+
{{#set: inchi key=InChIKey=VZBGWADXUJSBTI-PYDDKJGSSA-K}}
+
{{#set: molecular weight=451.456    }}
+
{{#set: common name=tetrahydroGGPP|tetrahydrogeranylgeranyl pyrophosphate|tetrahydrogeranylgeranyl-PP}}
+
{{#set: reversible reaction associated=RXN-7659|RXN-7660}}
+

Latest revision as of 20:00, 21 March 2018

Gene Tiso_gene_6869

  • Synonym(s):

Reactions associated

Pathways associated

External links