Difference between revisions of "DIHYDRONEOPTERIN-P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10269 CPD-10269] == * smiles: ** CCCCCCC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRONEOPTERIN-P DIHYDRONEOPTERIN-P] == * smiles: ** C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)COP(=O)...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDRONEOPTERIN-P DIHYDRONEOPTERIN-P] == |
* smiles: | * smiles: | ||
− | ** | + | ** C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)COP(=O)([O-])[O-])=2)) |
* common name: | * common name: | ||
− | ** | + | ** 7,8-dihydroneopterin 3'-phosphate |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=PLSQMGZYOGSOCE-XINAWCOVSA-L |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 333.197 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** dihydroneopterin 3'-monophosphate |
− | ** | + | ** dihydroneopterin-P |
− | ** | + | ** 2-amino-4-hydroxy-6-(erythro-1,2,3-trihydroxypropyl)dihydropteridine phosphate |
− | ** | + | ** dihydroneopterin 3'-phosphate |
− | ** | + | ** 7,8-dihydro-D-neopterin 3'-phosphate |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]] |
− | + | ||
− | + | ||
− | + | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[RXN | + | * [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]] |
− | + | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-CPD: |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05925 C05925] |
+ | * HMDB : HMDB06824 | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58762 58762] |
− | * | + | * BIGG : dhpmp |
− | {{#set: smiles= | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245170 25245170] |
− | {{#set: inchi key=InChIKey= | + | {{#set: smiles=C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)COP(=O)([O-])[O-])=2))}} |
− | {{#set: molecular weight= | + | {{#set: common name=7,8-dihydroneopterin 3'-phosphate}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=PLSQMGZYOGSOCE-XINAWCOVSA-L}} |
− | {{#set: consumed by= | + | {{#set: molecular weight=333.197 }} |
− | {{#set: produced by=RXN | + | {{#set: common name=dihydroneopterin 3'-monophosphate|dihydroneopterin-P|2-amino-4-hydroxy-6-(erythro-1,2,3-trihydroxypropyl)dihydropteridine phosphate|dihydroneopterin 3'-phosphate|7,8-dihydro-D-neopterin 3'-phosphate}} |
+ | {{#set: consumed by=DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN}} | ||
+ | {{#set: produced by=H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN}} |
Latest revision as of 20:00, 21 March 2018
Contents
Metabolite DIHYDRONEOPTERIN-P
- smiles:
- C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)COP(=O)([O-])[O-])=2))
- common name:
- 7,8-dihydroneopterin 3'-phosphate
- inchi key:
- InChIKey=PLSQMGZYOGSOCE-XINAWCOVSA-L
- molecular weight:
- 333.197
- Synonym(s):
- dihydroneopterin 3'-monophosphate
- dihydroneopterin-P
- 2-amino-4-hydroxy-6-(erythro-1,2,3-trihydroxypropyl)dihydropteridine phosphate
- dihydroneopterin 3'-phosphate
- 7,8-dihydro-D-neopterin 3'-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)COP(=O)([O-])[O-])=2))" cannot be used as a page name in this wiki.