Difference between revisions of "Tiso gene 16719"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-B CHLOROPHYLL-B] == * smiles: ** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCC...")
(Created page with "Category:Gene == Gene Tiso_gene_16719 == * right end position: ** 3225 * transcription direction: ** NEGATIVE * left end position: ** 72 * centisome position: ** 1.7282765...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHLOROPHYLL-B CHLOROPHYLL-B] ==
+
== Gene Tiso_gene_16719 ==
−
* smiles:
+
* right end position:
−
** C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C(C=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)C(C(OC)=O)C5=C(N67)8)))))9))))
+
** 3225
−
* common name:
+
* transcription direction:
−
** chlorophyll b
+
** NEGATIVE
−
* molecular weight:
+
* left end position:
−
** 907.486    
+
** 72
 +
* centisome position:
 +
** 1.7282765    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[1.2.1.31-RXN]]
−
* [[RXN-7674]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
* Reaction: [[ALLYSINE-DEHYDROG-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[ASPARTATE-RACEMASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-10855]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY66-425]]
 +
* [[LYSINE-DEG1-PWY]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=3225}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11593175 11593175]
+
{{#set: transcription direction=NEGATIVE}}
−
* HMDB : HMDB31146
+
{{#set: left end position=72}}
−
* CHEBI:
+
{{#set: centisome position=1.7282765    }}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27888 27888]
+
{{#set: reaction associated=1.2.1.31-RXN|ALLYSINE-DEHYDROG-RXN|ASPARTATE-RACEMASE-RXN|RXN-10855}}
−
* LIGAND-CPD:
+
{{#set: pathway associated=PWY66-425|LYSINE-DEG1-PWY}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05307 C05307]
+
−
{{#set: smiles=C=CC2(C(C)=C4(C=C9(C(C)C(CCC(=O)OCC=C(C)CCCC(C)CCCC(C)CCCC(C)C)C5(=N([Mg]36(N1(=C(C(CC)=C(C=O)C1=CC=2N34)C=C7(C(C)=C8(C(=O)C(C(OC)=O)C5=C(N67)8)))))9))))}}
+
−
{{#set: common name=chlorophyll b}}
+
−
{{#set: molecular weight=907.486    }}
+
−
{{#set: produced by=RXN-7674}}
+

Latest revision as of 21:00, 21 March 2018

Gene Tiso_gene_16719

  • right end position:
    • 3225
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 72
  • centisome position:
    • 1.7282765
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_16719&oldid=45191"