Difference between revisions of "CPD-17049"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_15143 == * right end position: ** 5037 * transcription direction: ** POSITIVE * left end position: ** 3727 * centisome position: ** 71.5767...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17049 CPD-17049] == * smiles: ** C(O)C2(S)(NC(=O)C(S)(CC1(=CC=CC=C1))NC(=O)2) * common name...")
 
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Tiso_gene_15143 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17049 CPD-17049] ==
−
* right end position:
+
* smiles:
−
** 5037
+
** C(O)C2(S)(NC(=O)C(S)(CC1(=CC=CC=C1))NC(=O)2)
−
* transcription direction:
+
* common name:
−
** POSITIVE
+
** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine
−
* left end position:
+
* inchi key:
−
** 3727
+
** InChIKey=VZGSJJJQZPTKGR-VXGBXAGGSA-N
−
* centisome position:
+
* molecular weight:
−
** 71.57673    
+
** 298.374    
 
* Synonym(s):
 
* Synonym(s):
 +
** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-DKP
 +
** 3-benzyl-3,6 -dithio-6-(hydroxymethyl)piperazine-2,5-dione
 +
** 3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-diketopiperazine
 +
** 3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-DKP
 +
** 3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)piperazine-2,5-dione
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* Reaction: [[2.7.1.127-RXN]]
+
* [[RXN-15684]]
−
** Source: [[annotation-in-silico_annotation]]
+
== Reaction(s) known to produce the compound ==
−
*** Assignment: ec-number
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
−
* [[PWY-6364]]
+
−
* [[PWY-6362]]
+
−
* [[PWY-6361]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: right end position=5037}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658023 90658023]
−
{{#set: left end position=3727}}
+
{{#set: smiles=C(O)C2(S)(NC(=O)C(S)(CC1(=CC=CC=C1))NC(=O)2)}}
−
{{#set: centisome position=71.57673   }}
+
{{#set: common name=3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine}}
−
{{#set: reaction associated=2.7.1.127-RXN}}
+
{{#set: inchi key=InChIKey=VZGSJJJQZPTKGR-VXGBXAGGSA-N}}
−
{{#set: pathway associated=PWY-6364|PWY-6362|PWY-6361}}
+
{{#set: molecular weight=298.374   }}
 +
{{#set: common name=3-benzyl-3,6 -dithio-6-(hydroxymethyl)-DKP|3-benzyl-3,6 -dithio-6-(hydroxymethyl)piperazine-2,5-dione|3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-diketopiperazine|3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-DKP|3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)piperazine-2,5-dione}}
 +
{{#set: consumed by=RXN-15684}}

Latest revision as of 20:00, 21 March 2018

Metabolite CPD-17049

  • smiles:
    • C(O)C2(S)(NC(=O)C(S)(CC1(=CC=CC=C1))NC(=O)2)
  • common name:
    • 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-diketopiperazine
  • inchi key:
    • InChIKey=VZGSJJJQZPTKGR-VXGBXAGGSA-N
  • molecular weight:
    • 298.374
  • Synonym(s):
    • 3-benzyl-3,6 -dithio-6-(hydroxymethyl)-DKP
    • 3-benzyl-3,6 -dithio-6-(hydroxymethyl)piperazine-2,5-dione
    • 3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-diketopiperazine
    • 3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)-DKP
    • 3-benzyl-3,6 -disulfanyl- 6-(hydroxymethyl)piperazine-2,5-dione

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-17049&oldid=45222"