Difference between revisions of "5-OXOPROLINASE-ATP-HYDROLYSING-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-DEHYDRO-ASCORBATE L-DEHYDRO-ASCORBATE] == * smiles: ** C(O)C(O)C1(C(=O)C(=O)C(=O)O1) * common...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=5-OXOPROLINASE-ATP-HYDROLYSING-RXN 5-OXOPROLINASE-ATP-HYDROLYSING-RXN] == * direction: ** LEFT-TO-R...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=5-OXOPROLINASE-ATP-HYDROLYSING-RXN 5-OXOPROLINASE-ATP-HYDROLYSING-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
* common name: | * common name: | ||
− | ** | + | ** 5-oxoprolinase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/3.5.2.9 EC-3.5.2.9] |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 2 [[WATER]][c] '''+''' 1 [[5-OXOPROLINE]][c] '''+''' 1 [[ATP]][c] '''=>''' 1 [[Pi]][c] '''+''' 1 [[GLT]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[ADP]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 2 H2O[c] '''+''' 1 5-oxo-L-proline[c] '''+''' 1 ATP[c] '''=>''' 1 phosphate[c] '''+''' 1 L-glutamate[c] '''+''' 1 H+[c] '''+''' 1 ADP[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | * [[ | + | * Gene: [[Tiso_gene_3358]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | == | + | *** Assignment: AUTOMATED-NAME-MATCH |
− | * [[ | + | * Gene: [[Tiso_gene_3359]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways == | ||
+ | * [[PWY-4041]], γ-glutamyl cycle: [http://metacyc.org/META/NEW-IMAGE?object=PWY-4041 PWY-4041] | ||
+ | ** '''5''' reactions found over '''6''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | ** [http://www. | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=10348 10348] |
− | * | + | * LIGAND-RXN: |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00251 R00251] | |
− | ** [http://www. | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/P97608 P97608] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | ** [http:// | + | {{#set: common name=5-oxoprolinase}} |
− | {{#set: | + | {{#set: ec number=EC-3.5.2.9}} |
− | {{#set: common name= | + | {{#set: gene associated=Tiso_gene_3358|Tiso_gene_3359}} |
− | {{#set: | + | {{#set: in pathway=PWY-4041}} |
− | {{#set: | + | {{#set: reconstruction category=orthology|annotation}} |
− | {{#set: | + | {{#set: reconstruction source=orthology-creinhardtii|orthology-athaliana|annotation-in-silico_annotation|orthology-esiliculosus}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 21:02, 21 March 2018
Contents
Reaction 5-OXOPROLINASE-ATP-HYDROLYSING-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- 5-oxoprolinase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 2 H2O[c] + 1 5-oxo-L-proline[c] + 1 ATP[c] => 1 phosphate[c] + 1 L-glutamate[c] + 1 H+[c] + 1 ADP[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_3358
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_3359
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-athaliana
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links