Difference between revisions of "CPD-13576"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Charged-GLN-tRNAs Charged-GLN-tRNAs] == * common name: ** an L-glutaminyl-[tRNAgln] * Synonym(s...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13576 CPD-13576] == * smiles: ** CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1) * common name:...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13576 CPD-13576] == |
+ | * smiles: | ||
+ | ** CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1) | ||
* common name: | * common name: | ||
− | ** | + | ** 2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate |
+ | * inchi key: | ||
+ | ** InChIKey=XWECMAHAKFWYNV-UHFFFAOYSA-K | ||
+ | * molecular weight: | ||
+ | ** 264.169 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** cThz-P |
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-12610]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
− | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53477624 53477624] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62890 62890] | ||
+ | {{#set: smiles=CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1)}} | ||
+ | {{#set: common name=2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate}} | ||
+ | {{#set: inchi key=InChIKey=XWECMAHAKFWYNV-UHFFFAOYSA-K}} | ||
+ | {{#set: molecular weight=264.169 }} | ||
+ | {{#set: common name=cThz-P}} | ||
+ | {{#set: consumed by=RXN-12610}} |
Latest revision as of 21:02, 21 March 2018
Contents
Metabolite CPD-13576
- smiles:
- CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1)
- common name:
- 2-(2-carboxy-4-methylthiazol-5-yl)ethyl phosphate
- inchi key:
- InChIKey=XWECMAHAKFWYNV-UHFFFAOYSA-K
- molecular weight:
- 264.169
- Synonym(s):
- cThz-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(=C(CCOP([O-])(=O)[O-])SC(C(=O)[O-])=N1)" cannot be used as a page name in this wiki.