Difference between revisions of "THZ-P"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_20270 == * right end position: ** 1561 * transcription direction: ** POSITIVE * left end position: ** 252 * centisome position: ** 15.86901...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THZ-P THZ-P] == * smiles: ** CC1(N=CSC(CCOP([O-])(=O)[O-])=1) * common name: ** 4-methyl-5-(2-p...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THZ-P THZ-P] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC1(N=CSC(CCOP([O-])(=O)[O-])=1) |
| − | * | + | * common name: |
| − | ** | + | ** 4-methyl-5-(2-phosphooxyethyl)thiazole |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=OCYMERZCMYJQQO-UHFFFAOYSA-L |
| − | * | + | * molecular weight: |
| − | ** | + | ** 221.167 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 4-4-methyl-5-(2-phosphonooxyethyl)-thiazole | ||
| + | ** 4-methyl-5-(2-phosphoethyl)-thiazole | ||
| + | ** THZ-P | ||
| + | ** 4-methyl-5-(β-hydroxyethyl)thiazole phosphate | ||
| + | ** HET-P | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[THI-P-SYN-RXN]] |
| − | * | + | == Reaction(s) known to produce the compound == |
| − | + | * [[THIAZOLSYN3-RXN]] | |
| − | == | + | == Reaction(s) of unknown directionality == |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245616 25245616] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58296 58296] |
| − | {{#set: | + | * BIGG : 4mpetz |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C04327 C04327] | ||
| + | {{#set: smiles=CC1(N=CSC(CCOP([O-])(=O)[O-])=1)}} | ||
| + | {{#set: common name=4-methyl-5-(2-phosphooxyethyl)thiazole}} | ||
| + | {{#set: inchi key=InChIKey=OCYMERZCMYJQQO-UHFFFAOYSA-L}} | ||
| + | {{#set: molecular weight=221.167 }} | ||
| + | {{#set: common name=4-4-methyl-5-(2-phosphonooxyethyl)-thiazole|4-methyl-5-(2-phosphoethyl)-thiazole|THZ-P|4-methyl-5-(β-hydroxyethyl)thiazole phosphate|HET-P}} | ||
| + | {{#set: consumed by=THI-P-SYN-RXN}} | ||
| + | {{#set: produced by=THIAZOLSYN3-RXN}} | ||
Latest revision as of 20:02, 21 March 2018
Contents
Metabolite THZ-P
- smiles:
- CC1(N=CSC(CCOP([O-])(=O)[O-])=1)
- common name:
- 4-methyl-5-(2-phosphooxyethyl)thiazole
- inchi key:
- InChIKey=OCYMERZCMYJQQO-UHFFFAOYSA-L
- molecular weight:
- 221.167
- Synonym(s):
- 4-4-methyl-5-(2-phosphonooxyethyl)-thiazole
- 4-methyl-5-(2-phosphoethyl)-thiazole
- THZ-P
- 4-methyl-5-(β-hydroxyethyl)thiazole phosphate
- HET-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(N=CSC(CCOP([O-])(=O)[O-])=1)" cannot be used as a page name in this wiki.
