Difference between revisions of "CPD-6993"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14384 RXN-14384] == * direction: ** LEFT-TO-RIGHT * common name: ** cysteine_mitochondrial ** c...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6993 CPD-6993] == * smiles: ** C2(C=CC(C=CC(C1(=C(C=C(C=C(O)1)O)O))=O)=CC=2) * common name:...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-6993 CPD-6993] == |
| − | * | + | * smiles: |
| − | ** | + | ** C2(C=CC(C=CC(C1(=C(C=C(C=C(O)1)O)O))=O)=CC=2) |
* common name: | * common name: | ||
| − | ** | + | ** pinocembrin chalcone |
| − | ** | + | * inchi key: |
| − | * | + | ** InChIKey=LOYXTWZXLWHMBX-VOTSOKGWSA-N |
| − | ** | + | * molecular weight: |
| + | ** 256.257 | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction | + | == Reaction(s) known to consume the compound == |
| − | + | * [[RXN-7647]] | |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | = | + | |
| − | + | ||
| − | * | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6474295 6474295] | |
| − | + | * CHEMSPIDER: | |
| − | + | ** [http://www.chemspider.com/Chemical-Structure.4976321.html 4976321] | |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=80484 80484] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16404 C16404] |
| − | {{#set: | + | {{#set: smiles=C2(C=CC(C=CC(C1(=C(C=C(C=C(O)1)O)O))=O)=CC=2)}} |
| + | {{#set: common name=pinocembrin chalcone}} | ||
| + | {{#set: inchi key=InChIKey=LOYXTWZXLWHMBX-VOTSOKGWSA-N}} | ||
| + | {{#set: molecular weight=256.257 }} | ||
| + | {{#set: consumed by=RXN-7647}} | ||
Latest revision as of 20:03, 21 March 2018
Contents
Metabolite CPD-6993
- smiles:
- C2(C=CC(C=CC(C1(=C(C=C(C=C(O)1)O)O))=O)=CC=2)
- common name:
- pinocembrin chalcone
- inchi key:
- InChIKey=LOYXTWZXLWHMBX-VOTSOKGWSA-N
- molecular weight:
- 256.257
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
