Difference between revisions of "RXN-12376"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1905 CPD0-1905] == * smiles: ** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12376 RXN-12376] == * direction: ** LEFT-TO-RIGHT * common name: ** trna_(guanine_-n1)-methyltr...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1905 CPD0-1905] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12376 RXN-12376] ==
−
* smiles:
+
* direction:
−
** C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** 8-oxo-dGTP
+
** trna_(guanine_-n1)-methyltransferase
−
* inchi key:
+
** probable_trna_(guanine_-n_)-dimethyltransferase_1
−
** InChIKey=BUZOGVVQWCXXDP-VPENINKCSA-J
+
* ec number:
−
* molecular weight:
+
** [http://enzyme.expasy.org/EC/2.1.1.216 EC-2.1.1.216]
−
** 519.151   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 8-oxo-7,8-dihydro-2'-dGTP
 
−
** 8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-triphosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-11410]]
+
** 1 [[tRNA-Containing-N2-Methylguanine-26]][c] '''+''' 1 [[S-ADENOSYLMETHIONINE]][c] '''=>''' 1 [[tRNA-Containing-N2-dimethylguanine-26]][c] '''+''' 1 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1 [[PROTON]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
−
* [[RXN-14205]]
+
** 1 an N2-methylguanine26 in tRNA[c] '''+''' 1 S-adenosyl-L-methionine[c] '''=>''' 1 an N2dimethylguanine26 in tRNA[c] '''+''' 1 S-adenosyl-L-homocysteine[c] '''+''' 1 H+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_9360]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_16307]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6829]], tRNA methylation (yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6829 PWY-6829]
 +
** '''3''' reactions found over '''15''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237341 44237341]
+
{{#set: common name=trna_(guanine_-n1)-methyltransferase}}
−
* CHEBI:
+
{{#set: common name=probable_trna_(guanine_-n_)-dimethyltransferase_1}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77896 77896]
+
{{#set: ec number=EC-2.1.1.216}}
−
{{#set: smiles=C(OP(=O)([O-])OP(=O)(OP([O-])([O-])=O)[O-])C1(OC(CC(O)1)N3(C(=O)NC2(C(=O)NC(N)=NC=23)))}}
+
{{#set: gene associated=Tiso_gene_9360|Tiso_gene_16307}}
−
{{#set: common name=8-oxo-dGTP}}
+
{{#set: in pathway=PWY-6829}}
−
{{#set: inchi key=InChIKey=BUZOGVVQWCXXDP-VPENINKCSA-J}}
+
{{#set: reconstruction category=annotation}}
−
{{#set: molecular weight=519.151    }}
+
{{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation}}
−
{{#set: common name=8-oxo-7,8-dihydro-2'-dGTP|8-oxo-7,8-dihydro-2'-deoxyguanosine 5'-triphosphate}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: produced by=RXN-11410}}
+
−
{{#set: reversible reaction associated=RXN-14205}}
+

Latest revision as of 21:03, 21 March 2018

Reaction RXN-12376

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • trna_(guanine_-n1)-methyltransferase
    • probable_trna_(guanine_-n_)-dimethyltransferase_1
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6829, tRNA methylation (yeast): PWY-6829
    • 3 reactions found over 15 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-12376&oldid=45602"