Difference between revisions of "RXN-11334"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7066 CPD-7066] == * smiles: ** CC(C(=O)[O-])C(O)C([O-])=O * common name: ** (2R,3S)-3-methy...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11334 RXN-11334] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/1.1...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Reaction]] |
| − | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11334 RXN-11334] == |
| − | * | + | * direction: |
| − | ** | + | ** REVERSIBLE |
| − | * | + | * ec number: |
| − | ** | + | ** [http://enzyme.expasy.org/EC/1.1.99.35 EC-1.1.99.35] |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
| − | == Reaction(s) | + | == Reaction Formula == |
| − | * [[ | + | * With identifiers: |
| − | == | + | ** 1 [[Glucopyranose]][c] '''+''' 1 [[Acceptor]][c] '''<=>''' 1 [[Donor-H2]][c] '''+''' 1 [[GLC-D-LACTONE]][c] |
| − | == | + | * With common name(s): |
| + | ** 1 D-glucopyranose[c] '''+''' 1 an oxidized electron acceptor[c] '''<=>''' 1 a reduced electron acceptor[c] '''+''' 1 D-glucono-1,5-lactone[c] | ||
| + | |||
| + | == Genes associated with this reaction == | ||
| + | Genes have been associated with this reaction based on different elements listed below. | ||
| + | * Gene: [[Tiso_gene_3229]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | == Pathways == | ||
| + | == Reconstruction information == | ||
| + | * Category: [[orthology]] | ||
| + | ** Source: [[orthology-esiliculosus]] | ||
| + | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
| − | * | + | * RHEA: |
| − | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24540 24540] | |
| − | + | {{#set: direction=REVERSIBLE}} | |
| − | ** [http://www.ebi.ac.uk/ | + | {{#set: ec number=EC-1.1.99.35}} |
| − | + | {{#set: gene associated=Tiso_gene_3229}} | |
| − | + | {{#set: in pathway=}} | |
| − | {{#set: | + | {{#set: reconstruction category=orthology}} |
| − | {{#set: | + | {{#set: reconstruction source=orthology-esiliculosus}} |
| − | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 20:03, 21 March 2018
Contents
Reaction RXN-11334
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 Glucopyranose[c] + 1 Acceptor[c] <=> 1 Donor-H2[c] + 1 GLC-D-LACTONE[c]
- With common name(s):
- 1 D-glucopyranose[c] + 1 an oxidized electron acceptor[c] <=> 1 a reduced electron acceptor[c] + 1 D-glucono-1,5-lactone[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_3229
- Source: orthology-esiliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
External links
- RHEA:
