Difference between revisions of "CPD-9446"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_8226 == * Synonym(s): == Reactions associated == * Reaction: F16BDEPHOS-RXN ** Source: annotation-in-silico_annotation *** Assignm...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9446 CPD-9446] == * smiles: ** C(O)C1(OCC(O)C(O)C(O)1) * common name: ** 1,5-anhydro-D-mann...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9446 CPD-9446] == |
| + | * smiles: | ||
| + | ** C(O)C1(OCC(O)C(O)C(O)1) | ||
| + | * common name: | ||
| + | ** 1,5-anhydro-D-mannitol | ||
| + | * inchi key: | ||
| + | ** InChIKey=MPCAJMNYNOGXPB-KVTDHHQDSA-N | ||
| + | * molecular weight: | ||
| + | ** 164.158 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** 1,5-anhydromannitol | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * | + | * [[RXN-13064]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=445184 445184] |
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.392897.html 392897] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=49182 49182] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C16538 C16538] | ||
| + | {{#set: smiles=C(O)C1(OCC(O)C(O)C(O)1)}} | ||
| + | {{#set: common name=1,5-anhydro-D-mannitol}} | ||
| + | {{#set: inchi key=InChIKey=MPCAJMNYNOGXPB-KVTDHHQDSA-N}} | ||
| + | {{#set: molecular weight=164.158 }} | ||
| + | {{#set: common name=1,5-anhydromannitol}} | ||
| + | {{#set: consumed by=RXN-13064}} | ||
Latest revision as of 20:04, 21 March 2018
Contents
Metabolite CPD-9446
- smiles:
- C(O)C1(OCC(O)C(O)C(O)1)
- common name:
- 1,5-anhydro-D-mannitol
- inchi key:
- InChIKey=MPCAJMNYNOGXPB-KVTDHHQDSA-N
- molecular weight:
- 164.158
- Synonym(s):
- 1,5-anhydromannitol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
