Difference between revisions of "CPD-4203"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_19647 == * right end position: ** 1984 * transcription direction: ** POSITIVE * left end position: ** 319 * centisome position: ** 14.88567...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4203 CPD-4203] == * smiles: ** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])[O-])([O-])=...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4203 CPD-4203] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])[O-])([O-])=O)O)O))C=NC=23)))C |
| − | * | + | * common name: |
| − | ** | + | ** N6-(Δ2-isopentenyl)-adenosine 5'-diphosphate |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=VXMXKDAHJURHEN-SDBHATRESA-K |
| − | * | + | * molecular weight: |
| − | ** | + | ** 492.298 |
* Synonym(s): | * Synonym(s): | ||
| + | ** iPDP | ||
| + | ** isopentenyladenosine riboside-5'-diphosphate | ||
| + | ** iPRDP | ||
| + | ** isopentenyladenosine-5'-diphosphate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | * | + | * [[RXN-4305]] |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202829 25202829] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=73533 73533] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C16426 C16426] |
| + | {{#set: smiles=CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])[O-])([O-])=O)O)O))C=NC=23)))C}} | ||
| + | {{#set: common name=N6-(Δ2-isopentenyl)-adenosine 5'-diphosphate}} | ||
| + | {{#set: inchi key=InChIKey=VXMXKDAHJURHEN-SDBHATRESA-K}} | ||
| + | {{#set: molecular weight=492.298 }} | ||
| + | {{#set: common name=iPDP|isopentenyladenosine riboside-5'-diphosphate|iPRDP|isopentenyladenosine-5'-diphosphate}} | ||
| + | {{#set: produced by=RXN-4305}} | ||
Latest revision as of 20:04, 21 March 2018
Contents
Metabolite CPD-4203
- smiles:
- CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])[O-])([O-])=O)O)O))C=NC=23)))C
- common name:
- N6-(Δ2-isopentenyl)-adenosine 5'-diphosphate
- inchi key:
- InChIKey=VXMXKDAHJURHEN-SDBHATRESA-K
- molecular weight:
- 492.298
- Synonym(s):
- iPDP
- isopentenyladenosine riboside-5'-diphosphate
- iPRDP
- isopentenyladenosine-5'-diphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])[O-])([O-])=O)O)O))C=NC=23)))C" cannot be used as a page name in this wiki.
