Difference between revisions of "RXN-9516"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-67 CPD-67] == * smiles: ** C(OP([O-])(=O)[O-])C([O-])=O * common name: ** 2-phosphoglycolat...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9516 RXN-9516] == * direction: ** LEFT-TO-RIGHT * common name: ** 3-oxo-hexanoyl-[acyl-carrier...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-67 CPD-67] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9516 RXN-9516] ==
−
* smiles:
+
* direction:
−
** C(OP([O-])(=O)[O-])C([O-])=O
+
** LEFT-TO-RIGHT
 
* common name:
 
* common name:
−
** 2-phosphoglycolate
+
** 3-oxo-hexanoyl-[acyl-carrier protein] synthase
−
* inchi key:
+
** 3-oxoacyl-synthase
−
** InChIKey=ASCFNMCAHFUBCO-UHFFFAOYSA-K
+
* ec number:
−
* molecular weight:
+
** [http://enzyme.expasy.org/EC/2.3.1.41 EC-2.3.1.41]
−
** 153.008   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 2-P-glycolate
 
−
** phosphoglycolate
 
−
** Phosphoglycolic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[GPH-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[Butanoyl-ACPs]][c] '''+''' 1 [[MALONYL-ACP]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[3-oxo-hexanoyl-ACPs]][c] '''+''' 1 [[ACP]][c] '''+''' 1 [[CARBON-DIOXIDE]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a butyryl-[acp][c] '''+''' 1 a malonyl-[acp][c] '''+''' 1 H+[c] '''=>''' 1 a 3-oxo-hexanoyl-[acp][c] '''+''' 1 a holo-[acyl-carrier protein][c] '''+''' 1 CO2[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_5939]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_14485]]
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_15991]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_19302]]
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-5971]], palmitate biosynthesis II (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5971 PWY-5971]
 +
** '''31''' reactions found over '''31''' reactions in the full pathway
 +
* [[PWY-7388]], octanoyl-[acyl-carrier protein] biosynthesis (mitochondria, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7388 PWY-7388]
 +
** '''9''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-synechocystis]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[manual]]
 +
** Source: [[manual-primary_network]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* BIGG : 2pglyc
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* PUBCHEM:
+
{{#set: common name=3-oxo-hexanoyl-[acyl-carrier protein] synthase}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24916760 24916760]
+
{{#set: common name=3-oxoacyl-synthase}}
−
* HMDB : HMDB00816
+
{{#set: ec number=EC-2.3.1.41}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Tiso_gene_5939|Tiso_gene_14485|Tiso_gene_15991|Tiso_gene_19302}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00988 C00988]
+
{{#set: in pathway=PWY-5971|PWY-7388}}
−
* CHEBI:
+
{{#set: reconstruction category=orthology|manual|annotation}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58033 58033]
+
{{#set: reconstruction source=annotation-experimental_annotation|orthology-esiliculosus|annotation-in-silico_annotation|orthology-athaliana|orthology-synechocystis|manual-primary_network}}
−
* METABOLIGHTS : MTBLC58033
+
{{#set: reconstruction tool=pantograph|pathwaytools}}
−
{{#set: smiles=C(OP([O-])(=O)[O-])C([O-])=O}}
+
−
{{#set: common name=2-phosphoglycolate}}
+
−
{{#set: inchi key=InChIKey=ASCFNMCAHFUBCO-UHFFFAOYSA-K}}
+
−
{{#set: molecular weight=153.008    }}
+
−
{{#set: common name=2-P-glycolate|phosphoglycolate|Phosphoglycolic acid}}
+
−
{{#set: consumed by=GPH-RXN}}
+

Latest revision as of 20:04, 21 March 2018

Reaction RXN-9516

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • 3-oxo-hexanoyl-[acyl-carrier protein] synthase
    • 3-oxoacyl-synthase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5971, palmitate biosynthesis II (bacteria and plants): PWY-5971
    • 31 reactions found over 31 reactions in the full pathway
  • PWY-7388, octanoyl-[acyl-carrier protein] biosynthesis (mitochondria, yeast): PWY-7388
    • 9 reactions found over 9 reactions in the full pathway

Reconstruction information

External links

"3-oxo-hexanoyl-[acyl-carrier protein] synthase" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-9516&oldid=45740"