Difference between revisions of "CPD-318"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15127 RXN-15127] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-318 CPD-318] == * smiles: ** C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1) * common name: ** monodehydroa...")
 
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15127 RXN-15127] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-318 CPD-318] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1)
* ec number:
+
* common name:
** [http://enzyme.expasy.org/EC/3.5.99.10 EC-3.5.99.10]
+
** monodehydroascorbate radical
 +
* inchi key:
 +
** InChIKey=LHFJOBMTAJJOTB-JLAZNSOCSA-N
 +
* molecular weight:
 +
** 175.118   
 
* Synonym(s):
 
* Synonym(s):
 +
** monodehydroascorbic acid
 +
** semidehydroascorbic acid
 +
** semidehydroascorbate
 +
** ascorbyl radical
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-3523]]
** 1 [[CPD-16015]][c] '''+''' 1 [[WATER]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[AMMONIUM]][c] '''+''' 1 [[PYRUVATE]][c]
+
* [[1.6.5.4-RXN]]
* With common name(s):
+
== Reaction(s) known to produce the compound ==
** 1 2-iminopropanoate[c] '''+''' 1 H2O[c] '''+''' 1 H+[c] '''=>''' 1 ammonium[c] '''+''' 1 pyruvate[c]
+
* [[RXN-10981]]
 
+
* [[RXN-3521]]
== Genes associated with this reaction  ==
+
== Reaction(s) of unknown directionality ==
== Pathways  ==
+
* [[PWY0-1535]], D-serine degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1535 PWY0-1535]
+
** '''2''' reactions found over '''3''' reactions in the full pathway
+
* [[TRYPDEG-PWY]], L-tryptophan degradation II (via pyruvate): [http://metacyc.org/META/NEW-IMAGE?object=TRYPDEG-PWY TRYPDEG-PWY]
+
** '''2''' reactions found over '''3''' reactions in the full pathway
+
* [[PWY-3661]], glycine betaine degradation I: [http://metacyc.org/META/NEW-IMAGE?object=PWY-3661 PWY-3661]
+
** '''4''' reactions found over '''7''' reactions in the full pathway
+
* [[SERDEG-PWY]], L-serine degradation: [http://metacyc.org/META/NEW-IMAGE?object=SERDEG-PWY SERDEG-PWY]
+
** '''2''' reactions found over '''3''' reactions in the full pathway
+
* [[PWY-5497]], purine nucleobases degradation II (anaerobic): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5497 PWY-5497]
+
** '''7''' reactions found over '''24''' reactions in the full pathway
+
* [[LCYSDEG-PWY]], L-cysteine degradation II: [http://metacyc.org/META/NEW-IMAGE?object=LCYSDEG-PWY LCYSDEG-PWY]
+
** '''3''' reactions found over '''3''' reactions in the full pathway
+
== Reconstruction information  ==
+
* Category: [[annotation]]
+
** Source: [[annotation-in-silico_annotation]]
+
*** Tool: [[pathwaytools]]
+
** Source: [[annotation-experimental_annotation]]
+
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: ec number=EC-3.5.99.10}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5483640 5483640]
{{#set: in pathway=PWY0-1535|TRYPDEG-PWY|PWY-3661|SERDEG-PWY|PWY-5497|LCYSDEG-PWY}}
+
* CHEBI:
{{#set: reconstruction category=annotation}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16504 16504]
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
+
* LIGAND-CPD:
{{#set: reconstruction tool=pathwaytools}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C01041 C01041]
 +
{{#set: smiles=C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1)}}
 +
{{#set: common name=monodehydroascorbate radical}}
 +
{{#set: inchi key=InChIKey=LHFJOBMTAJJOTB-JLAZNSOCSA-N}}
 +
{{#set: molecular weight=175.118    }}
 +
{{#set: common name=monodehydroascorbic acid|semidehydroascorbic acid|semidehydroascorbate|ascorbyl radical}}
 +
{{#set: consumed by=RXN-3523|1.6.5.4-RXN}}
 +
{{#set: produced by=RXN-10981|RXN-3521}}

Latest revision as of 21:04, 21 March 2018

Metabolite CPD-318

  • smiles:
    • C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1)
  • common name:
    • monodehydroascorbate radical
  • inchi key:
    • InChIKey=LHFJOBMTAJJOTB-JLAZNSOCSA-N
  • molecular weight:
    • 175.118
  • Synonym(s):
    • monodehydroascorbic acid
    • semidehydroascorbic acid
    • semidehydroascorbate
    • ascorbyl radical

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(O)C(O)[CH]1(C(O)=C(O)C(=O)O1)" cannot be used as a page name in this wiki.