Difference between revisions of "TRP-tRNAs"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL PHENYL] == * smiles: ** CC(=O)C1(C=CC=CC=1) * common name: ** acetophenone * inchi key:...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRP-tRNAs TRP-tRNAs] == * common name: ** a tRNAtrp * Synonym(s): ** TRNA(TRP) == Reaction(s)...")
 
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHENYL PHENYL] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TRP-tRNAs TRP-tRNAs] ==
* smiles:
+
** CC(=O)C1(C=CC=CC=1)
+
 
* common name:
 
* common name:
** acetophenone
+
** a tRNAtrp
* inchi key:
+
** InChIKey=KWOLFJPFCHCOCG-UHFFFAOYSA-N
+
* molecular weight:
+
** 120.151   
+
 
* Synonym(s):
 
* Synonym(s):
** phenylmethylketone
+
** TRNA(TRP)
** methylphenylketone
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[TRYPTOPHAN--TRNA-LIGASE-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[RXN-1302]]
 
 
== External links  ==
 
== External links  ==
* CAS : 98-86-2
+
{{#set: common name=a tRNAtrp}}
* DRUGBANK : DB04619
+
{{#set: common name=TRNA(TRP)}}
* PUBCHEM:
+
{{#set: consumed by=TRYPTOPHAN--TRNA-LIGASE-RXN}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7410 7410]
+
* HMDB : HMDB33910
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C07113 C07113]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.7132.html 7132]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27632 27632]
+
{{#set: smiles=CC(=O)C1(C=CC=CC=1)}}
+
{{#set: common name=acetophenone}}
+
{{#set: inchi key=InChIKey=KWOLFJPFCHCOCG-UHFFFAOYSA-N}}
+
{{#set: molecular weight=120.151    }}
+
{{#set: common name=phenylmethylketone|methylphenylketone}}
+
{{#set: reversible reaction associated=RXN-1302}}
+

Latest revision as of 20:05, 21 March 2018

Metabolite TRP-tRNAs

  • common name:
    • a tRNAtrp
  • Synonym(s):
    • TRNA(TRP)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links