Difference between revisions of "CPD-12015"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=R01752 R01752] == * direction: ** REVERSIBLE * common name: ** R260 * Synonym(s): == Reaction Form...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12015 CPD-12015] == * smiles: ** CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2)) * com...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=R01752 R01752] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12015 CPD-12015] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2))
 
* common name:
 
* common name:
−
** R260
+
** 6-sulfatoxymelatonin
 +
* inchi key:
 +
** InChIKey=QQEILXDLZRLTME-UHFFFAOYSA-M
 +
* molecular weight:
 +
** 327.331   
 
* Synonym(s):
 
* Synonym(s):
 +
** 6-sulphatoxymelatonin
 +
** 6-hydroxymelatoninsulfate
 +
** 6-hydroxymelatonin sulfate ester
 +
** acetamide, N-(2-(5-methoxy-6-(sulfooxy)-1H-indol-3-yl)ethyl)-
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1.0 [[NAD]][c] '''+''' 1.0 [[WATER]][c] '''+''' 1.0 [[GLYCERALD]][c] '''<=>''' 1.0 [[GLYCERATE]][c] '''+''' 1.0 [[PROTON]][c] '''+''' 1.0 [[NADH]][c]
+
* [[RXN-11058]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1.0 NAD+[c] '''+''' 1.0 H2O[c] '''+''' 1.0 D-glyceraldehyde[c] '''<=>''' 1.0 D-glycerate[c] '''+''' 1.0 H+[c] '''+''' 1.0 NADH[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_7322]]
+
−
** Source: [[orthology-synechocystis]]
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[orthology]]
+
−
** Source: [[orthology-synechocystis]]
+
−
*** Tool: [[pantograph]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=REVERSIBLE}}
+
* PUBCHEM:
−
{{#set: common name=R260}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=38988602 38988602]
−
{{#set: gene associated=Tiso_gene_7322}}
+
* CHEMSPIDER:
−
{{#set: in pathway=}}
+
** [http://www.chemspider.com/Chemical-Structure.58606.html 58606]
−
{{#set: reconstruction category=orthology}}
+
* HMDB : HMDB41815
−
{{#set: reconstruction source=orthology-synechocystis}}
+
{{#set: smiles=CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2))}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: common name=6-sulfatoxymelatonin}}
 +
{{#set: inchi key=InChIKey=QQEILXDLZRLTME-UHFFFAOYSA-M}}
 +
{{#set: molecular weight=327.331    }}
 +
{{#set: common name=6-sulphatoxymelatonin|6-hydroxymelatoninsulfate|6-hydroxymelatonin sulfate ester|acetamide, N-(2-(5-methoxy-6-(sulfooxy)-1H-indol-3-yl)ethyl)-}}
 +
{{#set: produced by=RXN-11058}}

Latest revision as of 20:05, 21 March 2018

Metabolite CPD-12015

  • smiles:
    • CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2))
  • common name:
    • 6-sulfatoxymelatonin
  • inchi key:
    • InChIKey=QQEILXDLZRLTME-UHFFFAOYSA-M
  • molecular weight:
    • 327.331
  • Synonym(s):
    • 6-sulphatoxymelatonin
    • 6-hydroxymelatoninsulfate
    • 6-hydroxymelatonin sulfate ester
    • acetamide, N-(2-(5-methoxy-6-(sulfooxy)-1H-indol-3-yl)ethyl)-

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=O)NCCC1(C2(=C(NC=1)C=C(OS([O-])(=O)=O)C(OC)=C2))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-12015&oldid=45783"