Difference between revisions of "Tiso gene 18780"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14673 CPD-14673] == * smiles: ** C(#N)CCC1(C=CC=CC=1) * common name: ** 3-phenylpropionitri...")
(Created page with "Category:Gene == Gene Tiso_gene_18780 == * right end position: ** 2765 * transcription direction: ** POSITIVE * left end position: ** 3 * centisome position: ** 0.10710461...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14673 CPD-14673] ==
+
== Gene Tiso_gene_18780 ==
−
* smiles:
+
* right end position:
−
** C(#N)CCC1(C=CC=CC=1)
+
** 2765
−
* common name:
+
* transcription direction:
−
** 3-phenylpropionitrile
+
** POSITIVE
−
* inchi key:
+
* left end position:
−
** InChIKey=ACRWYXSKEHUQDB-UHFFFAOYSA-N
+
** 3
−
* molecular weight:
+
* centisome position:
−
** 131.177    
+
** 0.107104614    
 
* Synonym(s):
 
* Synonym(s):
−
** benzenepropanenitrile
 
−
** 2-phenylethyl cyanide
 
−
** 3-phenylpropanonitril
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-18229]]
+
* Reaction: [[ATPASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=2765}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12581 12581]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEMSPIDER:
+
{{#set: left end position=3}}
−
** [http://www.chemspider.com/Chemical-Structure.12061.html 12061]
+
{{#set: centisome position=0.107104614   }}
−
* CHEBI:
+
{{#set: reaction associated=ATPASE-RXN}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=85426 85426]
+
−
* HMDB : HMDB34236
+
−
{{#set: smiles=C(#N)CCC1(C=CC=CC=1)}}
+
−
{{#set: common name=3-phenylpropionitrile}}
+
−
{{#set: inchi key=InChIKey=ACRWYXSKEHUQDB-UHFFFAOYSA-N}}
+
−
{{#set: molecular weight=131.177   }}
+
−
{{#set: common name=benzenepropanenitrile|2-phenylethyl cyanide|3-phenylpropanonitril}}
+
−
{{#set: consumed by=RXN-18229}}
+

Latest revision as of 20:05, 21 March 2018

Gene Tiso_gene_18780

  • right end position:
    • 2765
  • transcription direction:
    • POSITIVE
  • left end position:
    • 3
  • centisome position:
    • 0.107104614
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_18780&oldid=45784"